CAS 374790-97-3
:4-Bromo-3-fluorobenzeneboronic acid
Description:
4-Bromo-3-fluorobenzeneboronic acid is an organoboron compound characterized by the presence of both bromine and fluorine substituents on a benzene ring, along with a boronic acid functional group. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the boronic acid group. The presence of the bromine and fluorine atoms introduces unique electronic properties, making it useful in various chemical reactions, particularly in Suzuki coupling reactions for the synthesis of biaryl compounds. The boronic acid functionality allows for the formation of stable complexes with diols, which can be exploited in various applications, including drug development and materials science. Additionally, 4-Bromo-3-fluorobenzeneboronic acid may exhibit interesting reactivity patterns due to the electron-withdrawing effects of the halogen substituents, influencing its behavior in organic synthesis and catalysis. Safety data should be consulted before handling, as with all chemical substances, to ensure proper precautions are taken.
Formula:C6H5BBrFO2
InChI:InChI=1/C6H5BBrFO2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,10-11H
SMILES:c1cc(c(cc1B(O)O)F)Br
Synonyms:- 4-Bromo-3-fluorophenylboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Bromo-3-fluorobenzeneboronic acid, 95%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C6H5BBrFO2Purity:95%Color and Shape:White to pale brown, PowderMolecular weight:218.824-Bromo-3-fluorobenzeneboronic acid
CAS:Formula:C6H5BBrFO2Purity:98%Color and Shape:SolidMolecular weight:218.81614-Bromo-3-fluorobenzeneboronic acid
CAS:4-Bromo-3-fluorobenzeneboronic acidPurity:97%Molecular weight:218.82g/mol4-Bromo-3-fluorobenzeneboronic acid
CAS:Formula:C6H5BBrFO2Purity:98%Color and Shape:SolidMolecular weight:218.82



