CAS 374795-42-3

tert-butyl 3-hydroxy-1-oxa-9-azaspiro[5.5]undecane-9-carboxylate

Description:

Tert-butyl 3-hydroxy-1-oxa-9-azaspiro[5.5]undecane-9-carboxylate, identified by its CAS number 374795-42-3, is a chemical compound characterized by its unique spirocyclic structure, which includes a nitrogen atom in a spiro configuration. This compound features a tert-butyl group, contributing to its hydrophobic properties, and a carboxylate functional group, which can enhance its solubility in polar solvents. The presence of the hydroxy group indicates potential for hydrogen bonding, influencing its reactivity and interaction with biological systems. The oxo and aza components suggest that it may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its structural complexity may also lead to unique physical properties, such as specific melting and boiling points, and it may display distinct behavior in various chemical reactions, including esterification and nucleophilic substitutions. Overall, this compound's characteristics make it a subject of interest in synthetic organic chemistry and potential applications in drug development.

Formula: C₁₄H₂₅NO₄

InChI: InChI=1/C14H25NO4/c1-13(2,3)19-12(17)15-8-6-14(7-9-15)5-4-11(16)10-18-14/h11,16H,4-10H2,1-3H3

SMILES: CC(C)(C)OC(=O)N1CCC2(CCC(CO2)O)CC1

Synonyms:

• tert-Butyl-3-hydroxy-1-oxa-9-azaspiro[5.5]undecan-9-carboxylat

1-Oxa-9-azaspiro[5.5]undecane-9-carboxylic acid, 3-hydroxy-, 1,1-dimethylethyl ester

CAS: 374795-42-3

Formula: C₁₄H₂₅NO₄

Purity: 96%

Color and Shape: Solid

Molecular weight: 271.3526

Ref: IN-DA00C6CD

tert-Butyl 3-hydroxy-1-oxa-9-azaspiro[5.5]undecane-9-carboxylate

CAS: 374795-42-3

tert-Butyl 3-hydroxy-1-oxa-9-azaspiro[5.5]undecane-9-carboxylate

Purity: 96%

Molecular weight: 271.35g/mol

Ref: 54-OR88824

tert-Butyl 3-hydroxy-1-oxa-9-azaspiro[5.5]undecane-9-carboxylate

CAS: 374795-42-3

Purity: 96%

Molecular weight: 271.3569946

Ref: 10-F787721