
CAS 3748-39-8
:2,3-Dihydro-2,5,8-trihydroxy-6-methoxy-2-methyl-4H-naphtho[2,3-b]pyran-4-one
Description:
2,3-Dihydro-2,5,8-trihydroxy-6-methoxy-2-methyl-4H-naphtho[2,3-b]pyran-4-one, with CAS number 3748-39-8, is a complex organic compound characterized by its naphthoquinone structure, which features multiple hydroxyl and methoxy functional groups. This compound exhibits a range of chemical properties, including potential antioxidant activity due to the presence of hydroxyl groups, which can donate hydrogen atoms and neutralize free radicals. Its methoxy group may enhance solubility in organic solvents and influence its reactivity. The compound's structure suggests it may participate in various chemical reactions, such as oxidation and reduction, and could serve as a precursor in synthetic organic chemistry. Additionally, its unique arrangement of functional groups may confer biological activity, making it of interest in pharmacological research. Overall, the compound's intricate structure and functional diversity position it as a subject of interest in both synthetic and medicinal chemistry.
Formula:C15H14O6
InChI:InChI=1S/C15H14O6/c1-15(19)6-9(17)13-11(21-15)4-7-3-8(16)5-10(20-2)12(7)14(13)18/h3-5,16,18-19H,6H2,1-2H3
InChI key:InChIKey=FKCYENFBFZUSDP-UHFFFAOYSA-N
SMILES:OC1=C2C(=CC3=C1C(OC)=CC(O)=C3)OC(C)(O)CC2=O
Synonyms:- 2,3-Dihydro-2,5,8-trihydroxy-6-methoxy-2-methyl-4H-naphtho[2,3-b]pyran-4-one
- O8-Demethylfonsecin B
- 4H-Naphtho[2,3-b]pyran-4-one, 2,3-dihydro-2,5,8-trihydroxy-6-methoxy-2-methyl-
- TMC 256B1
- Fonsecin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
