CAS 37490-33-8
:2-Cyclohexylethenylboronic acid
Description:
2-Cyclohexylethenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a cyclohexyl-substituted ethenyl moiety. This compound typically exhibits properties common to boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the cyclohexyl group contributes to its hydrophobic characteristics, influencing its solubility in organic solvents. Additionally, the ethenyl group provides a site for further chemical reactivity, allowing for potential participation in cross-coupling reactions, which are valuable in the formation of carbon-carbon bonds. The compound's reactivity and functional versatility make it a candidate for use in the development of pharmaceuticals and agrochemicals. As with many boronic acids, it is important to handle this substance with care, as it may exhibit sensitivity to moisture and air, which can affect its stability and reactivity.
Formula:C8H15BO2
InChI:InChI=1/C8H15BO2/c10-9(11)7-6-8-4-2-1-3-5-8/h6-8,10-11H,1-5H2/b7-6+
Synonyms:- (2-Cyclohexylvinyl)boronic acid
- boronic acid, B-(2-cyclohexylethenyl)-
- [(E)-2-cyclohexylethenyl]boronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(2-Cyclohexylvinyl)boronic acid
CAS:Formula:C8H15BO2Purity:95%Color and Shape:SolidMolecular weight:154.01452-Cyclohexylvinylboronic acid
CAS:2-Cyclohexylvinylboronic acid
Purity:97%Molecular weight:154.01g/mol(2-Cyclohexylvinyl)boronic acid
CAS:Formula:C8H15BO2Purity:95%Color and Shape:SolidMolecular weight:154.022-Cyclohexylethenylboronic acid
CAS:2-Cyclohexylethenylboronic acid is an intermediate in the synthesis of petasis, a drug that is used to treat epilepsy. This compound is enantioenriched and diastereoselectively synthesized from 2-bromoethanol and cyclohexene with sodium acetate as the catalyst. The method for synthesis includes the addition of boron trifluoride etherate to the reaction mixture, which produces aldehydes in an enantiomeric ratio of greater than 99%.Formula:C8H15BO2Purity:Min. 95%Color and Shape:SolidMolecular weight:154.01 g/mol2-Cyclohexylvinylboronic Acid
CAS:Controlled ProductApplications 2-Cyclohexylvinylboronic Acid is used in the synthesis of vinylbenziodoxolones, a novel type of hypervalent iodine(III) reagents.
References Stridfeldt, E., et al.: Chem. Eur. J., 22, 16066-16070 (2016)Formula:C8H15BO2Color and Shape:NeatMolecular weight:154.01




