CAS 374910-04-0
:3-furan-2-yl-3-phenylpropan-1-amine
Description:
3-Furan-2-yl-3-phenylpropan-1-amine, identified by its CAS number 374910-04-0, is an organic compound characterized by its unique structure, which includes a furan ring and a phenyl group attached to a propan-1-amine backbone. This compound typically exhibits properties associated with both aromatic and aliphatic amines, such as moderate solubility in polar solvents and potential reactivity due to the presence of the amine functional group. The furan moiety contributes to its potential biological activity, as furan derivatives are often explored for their pharmacological properties. The compound may also display interesting electronic properties due to the conjugation between the furan and phenyl groups. In terms of safety and handling, like many amines, it may be sensitive to oxidation and should be handled with care to avoid exposure. Overall, 3-furan-2-yl-3-phenylpropan-1-amine represents a class of compounds that could be of interest in medicinal chemistry and materials science.
Formula:C13H15NO
InChI:InChI=1/C13H15NO/c14-9-8-12(13-7-4-10-15-13)11-5-2-1-3-6-11/h1-7,10,12H,8-9,14H2
SMILES:c1ccc(cc1)C(CCN)c1ccco1
Synonyms:- 2-Furanpropanamine, gamma-phenyl-
- 3-(2-Furyl)-3-phenylpropan-1-amine
- 3-Furan-2-yl-3-phenyl-propylamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
