CAS 374911-94-1

1-[3-(6-bromo-2H-1,3-benzoxazin-3(4H)-yl)phenyl]ethanone

Description:

1-[3-(6-bromo-2H-1,3-benzoxazin-3(4H)-yl)phenyl]ethanone, with the CAS number 374911-94-1, is a synthetic organic compound characterized by its complex structure, which includes a benzoxazine moiety and an ethanone functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the bromine substituent. The benzoxazine ring contributes to its potential biological activity, making it of interest in medicinal chemistry. The presence of the ethanone group suggests that it may participate in various chemical reactions, including nucleophilic attacks or condensation reactions. Additionally, the bromine atom can enhance the compound's lipophilicity and influence its interaction with biological targets. Overall, this compound's unique structure may confer specific pharmacological properties, warranting further investigation for applications in drug development or as a chemical probe in biological studies.

Formula: C₁₆H₁₄BrNO₂

InChI: InChI=1/C16H14BrNO2/c1-11(19)12-3-2-4-15(8-12)18-9-13-7-14(17)5-6-16(13)20-10-18/h2-8H,9-10H2,1H3

SMILES: CC(=O)c1cccc(c1)N1Cc2cc(ccc2OC1)Br

Synonyms:

• Ethanone, 1-[3-(6-bromo-2H-1,3-benzoxazin-3(4H)-yl)phenyl]-
• 1-[3-(6-Bromo-2H-1,3-benzoxazin-3(4H)-yl)phenyl]ethanone

1-(3-(6-Bromo-2H-benzo[e][1,3]oxazin-3(4H)-yl)phenyl)ethanone

CAS: 374911-94-1

Formula: C₁₆H₁₄BrNO₂

Molecular weight: 332.1919

Ref: IN-DA00C5X2

1-[3-(6-bromo-2H-1,3-benzoxazin-3(4H)-yl)phenyl]ethanone

CAS: 374911-94-1

Purity: 95.0%

Molecular weight: 332.1969909667969

Ref: 10-F314999