CAS 374933-28-5

N-[(1R)-1-(naphthalen-1-yl)ethyl]-1H-indole-2-carboxamide

Description:

N-[(1R)-1-(naphthalen-1-yl)ethyl]-1H-indole-2-carboxamide, with the CAS number 374933-28-5, is a chemical compound characterized by its complex structure, which includes an indole moiety and a naphthyl group. This compound features a carboxamide functional group, contributing to its potential biological activity. The presence of the naphthyl group suggests possible interactions with aromatic systems, which may influence its solubility and binding properties. The (1R)-1-(naphthalen-1-yl)ethyl substituent indicates stereochemistry that can affect the compound's pharmacological profile, including its receptor binding affinity and selectivity. Typically, compounds of this nature are investigated for their potential therapeutic applications, particularly in the fields of neuroscience and oncology, due to their ability to modulate biological pathways. Additionally, the indole structure is often associated with various biological activities, making this compound of interest in medicinal chemistry research. Overall, its unique structural features may provide insights into its functionality and potential uses in drug development.

Formula: C₂₁H₁₈N₂O

InChI: InChI=1/C21H18N2O/c1-14(17-11-6-9-15-7-2-4-10-18(15)17)22-21(24)20-13-16-8-3-5-12-19(16)23-20/h2-14,23H,1H3,(H,22,24)/t14-/m1/s1

SMILES: C[C@H](c1cccc2ccccc12)N=C(c1cc2ccccc2[nH]1)O

Calindol Amide

Controlled Product

CAS: 374933-28-5

Applications Intermediate in the preparation of Calindol

Formula: C₂₁H₁₈N₂O

Color and Shape: Neat

Molecular weight: 314.38

Ref: TR-C148650