CAS 37497-47-5

2,3-Dihydroxypropyl (5Z,11α,13E,15S)-11,15-dihydroxy-9-oxoprosta-5,13-dien-1-oate

Description:

2,3-Dihydroxypropyl (5Z,11α,13E,15S)-11,15-dihydroxy-9-oxoprosta-5,13-dien-1-oate, identified by its CAS number 37497-47-5, is a complex organic compound belonging to the class of prostaglandin derivatives. This substance features multiple hydroxyl groups, which contribute to its hydrophilicity and potential biological activity. The presence of a keto group and the specific stereochemistry indicated by the nomenclature suggest that it may interact with biological systems, possibly influencing physiological processes such as inflammation or vascular function. The structural configuration, including the double bonds and stereocenters, is crucial for its reactivity and interaction with receptors. As a derivative of prostaglandins, it may exhibit properties similar to those of other prostaglandin analogs, including modulation of smooth muscle contraction and involvement in various signaling pathways. Its solubility, stability, and reactivity would depend on the surrounding conditions, such as pH and temperature, making it an interesting subject for further pharmacological studies.

Formula: C₂₃H₃₈O₇

InChI: InChI=1S/C23H38O7/c1-2-3-6-9-17(25)12-13-20-19(21(27)14-22(20)28)10-7-4-5-8-11-23(29)30-16-18(26)15-24/h4,7,12-13,17-20,22,24-26,28H,2-3,5-6,8-11,14-16H2,1H3/b7-4-,13-12+/t17-,18?,19+,20+,22+/m0/s1

InChI key: InChIKey=RJXVYMMSQBYEHN-LVXZDWGESA-N

SMILES: C(=C/[C@H](CCCCC)O)\[C@@H]1[C@@H](C/C=C\CCCC(OCC(CO)O)=O)C(=O)C[C@H]1O

Synonyms:

• Prosta-5,13-dien-1-oic acid, 11,15-dihydroxy-9-oxo-, 2,3-dihydroxypropyl ester, (5Z,11α,13E,15S)-
• 2,3-Dihydroxypropyl (5Z,11α,13E,15S)-11,15-dihydroxy-9-oxoprosta-5,13-dien-1-oate

Prostaglandin E2-1-glyceryl ester

CAS: 37497-47-5

Prostaglandin E2-1-glyceryl ester, a member of the Prostaglandin Glycerol Ester family, serves as an endocannabinoid ligand targeting the CB1 receptor. This compound triggers a swift and transient surge in intracellular free calcium levels [1] [2].

Formula: C₂₃H₃₈O₇

Color and Shape: Solid

Molecular weight: 426.55

Ref: TM-T84637