CAS 375-01-9: 2,2,3,3,4,4,4-Heptafluorobutanol
Description:2,2,3,3,4,4,4-Heptafluorobutanol is a fluorinated alcohol characterized by its unique structure, which includes seven fluorine atoms attached to a butanol backbone. This compound is a colorless liquid at room temperature and is known for its high volatility and low surface tension. It exhibits strong hydrogen bonding due to the presence of the hydroxyl (-OH) group, which contributes to its solubility in polar solvents. The extensive fluorination imparts significant chemical stability and resistance to oxidation, making it useful in various applications, including as a solvent and in the synthesis of fluorinated compounds. Additionally, 2,2,3,3,4,4,4-Heptafluorobutanol has low toxicity, but safety precautions should still be observed due to the potential environmental impact of fluorinated compounds. Its unique properties make it a subject of interest in both industrial and research settings, particularly in the fields of materials science and organic chemistry.
Formula:C4H3F7O
InChI:InChI=1S/C4H3F7O/c5-2(6,1-12)3(7,8)4(9,10)11/h12H,1H2
InChI key:InChIKey=WXJFKAZDSQLPBX-UHFFFAOYSA-N
SMILES:FC(F)(F)C(F)(F)C(F)(F)CO
- Synonyms:
- (Perfluoropropyl)methanol
- 1,1-Dihydroperfluoro-1-butanol
- 1,1-Dihydroperfluorobutanol
- 1,1-Dihydroperfluorobutyl alcohol
- 1,1-H,H-Heptafluorobutanol
- 1-Butanol, 2,2,3,3,4,4,4-heptafluoro-
- 1H,1H-Heptafluoro-1-butanol
- 1H,1H-Heptafluorobutanol
- 1H,1H-Heptafluorobutanol-1
- 2,2,3,3,4,4,4-Heptafluoro-1-butanol
- See more synonyms
- 2,2,3,3,4,4,4-Heptafluorobutanol
- Ai3-29339
- Brn 1761907
- Butanol, 2,2,3,3,4,4,4-heptafluoro-
- Heptafluoro-1,1-dihydrobutyl alcohol
- Heptafluorobutanol
- Nsc 60528
- alpha,alpha-Dihydroperfluorobutanol
- α,α-Dihydroperfluorobutanol