CAS 375-51-9

2-Iodononafluorobutane

Description:

2-Iodononafluorobutane, with the CAS number 375-51-9, is a halogenated organic compound characterized by the presence of both iodine and fluorine atoms in its molecular structure. This compound features a butane backbone, which consists of four carbon atoms, and is specifically substituted at the second carbon position with an iodine atom, while the remaining carbon atoms are fully fluorinated. The presence of multiple fluorine atoms imparts unique properties, such as high thermal stability and low surface tension, making it useful in various applications, including as a solvent or in specialized chemical syntheses. Additionally, the iodine atom can enhance reactivity, allowing for further chemical transformations. 2-Iodononafluorobutane is typically a colorless liquid at room temperature and may exhibit low volatility due to the strong C-F bonds. Safety considerations are important when handling this compound, as both iodine and fluorinated compounds can pose health risks. Proper storage and handling protocols should be followed to mitigate any potential hazards associated with its use.

Formula: C₄F₉I

InChI: InChI=1/C4F9I/c5-1(6,3(8,9)10)2(7,14)4(11,12)13

SMILES: C(C(C(F)(F)F)(F)I)(C(F)(F)F)(F)F

Synonyms:

• 2-Iodoperfluorobutane~Perfluoroisobutyl iodide
• 1,1,1,2,2,3,4,4,4-Nonafluoro-3-Iodobutane

2-IODONONAFLUOROBUTANE

CAS: 375-51-9

Formula: C₄F₉I

Purity: 98%

Molecular weight: 345.9329

Ref: IN-DA003HGX

2-Iodononafluorobutane

CAS: 375-51-9

2-Iodononafluorobutane

Purity: 98%

Color and Shape: Pale Yellow Liquid

Molecular weight: 345.93g/mol

Ref: 54-PC4928

2-Iodononafluorobutane

CAS: 375-51-9

Formula: C₄F₉I

Purity: 98.0%

Color and Shape: Liquid

Molecular weight: 345.934

Ref: 10-F006661

2-Iodononafluorobutane

CAS: 375-51-9

2-Iodononafluorobutane is a halogenated organic compound, which is commonly used in the field of organic chemistry as a specialized reagent. It is derived from nonafluorobutyl iodide, and it exhibits unique reactivity due to the presence of both iodine and fluorine atoms within its molecular structure. These halogens confer distinct characteristics, including enhanced electronegativity and bond polarity, making the compound highly effective for specific chemical transformations.The mode of action of 2-Iodononafluorobutane primarily involves its role as an electrophile, reacting with nucleophiles in various synthetic pathways. The highly electronegative fluorine atoms influence the compound's reactivity profile, often facilitating reactions such as nucleophilic substitutions and coupling processes. Its utility is further underscored by the ability to introduce fluorinated groups into organic molecules, a key step in the development of pharmaceuticals, agrochemicals, and advanced materials.Applications of 2-Iodononafluorobutane are extensive in synthetic organic chemistry, where it is employed to achieve selective carbon-iodine bond formation or functional group transformations. Its role as a building block in the synthesis of complex fluorinated compounds is invaluable for research and development across multiple scientific disciplines.

Formula: C₄F₉I

Purity: Min. 95%

Molecular weight: 345.93 g/mol

Ref: 3D-FI77508