CAS 375-94-0

1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-nonadecafluorononane

Description:

1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-nonadecafluorononane, commonly referred to as perfluorononane, is a fully fluorinated hydrocarbon belonging to the class of perfluorocarbons (PFCs). This compound features a long carbon chain with a total of nine carbon atoms, each of which is fully substituted with fluorine atoms, resulting in a highly stable and non-polar molecule. Its chemical structure imparts unique properties, such as low surface tension, high thermal stability, and resistance to chemical degradation. Perfluorononane is typically colorless and odorless, and it is insoluble in water while being soluble in organic solvents. Due to its inertness, it is often used in various applications, including as a solvent, in electronics, and in specialized coatings. However, like many PFCs, it raises environmental concerns due to its persistence in the environment and potential bioaccumulation. Regulatory scrutiny has increased regarding its use and impact on human health and ecosystems.

Formula: C₉HF₁₉

InChI: InChI=1/C9HF19/c10-1(11)2(12,13)3(14,15)4(16,17)5(18,19)6(20,21)7(22,23)8(24,25)9(26,27)28/h1H

SMILES: C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F

1H-Perfluorononane

CAS: 375-94-0

1H-Perfluorononane

Formula: C₉HF₁₉

Purity: tech

Color and Shape: clear liquid

Molecular weight: 470.07g/mol

Ref: 54-PC9754