CAS 37520-06-2
:5-deoxypent-4-ulosonic acid
Description:
5-Deoxypent-4-ulosonic acid, also known as Kdo (2-keto-3-deoxy-D-manno-octulosonic acid), is a sugar acid that plays a significant role in the structure of bacterial lipopolysaccharides. It is characterized by its unique five-carbon backbone and a keto group, which distinguishes it from other sugar acids. This compound is typically found in the outer membrane of Gram-negative bacteria, contributing to the structural integrity and functionality of the bacterial cell wall. Kdo is involved in various biological processes, including cell recognition and immune response. Its structure allows for the formation of glycosidic bonds with other sugars, facilitating the assembly of complex polysaccharides. The presence of functional groups such as carboxylic acids and ketones contributes to its reactivity and solubility in aqueous environments. Due to its biological significance, Kdo is of interest in microbiology and biochemistry, particularly in studies related to bacterial pathogenesis and the development of vaccines.
Formula:C5H8O5
InChI:InChI=1/C5H8O5/c1-2(6)3(7)4(8)5(9)10/h3-4,7-8H,1H3,(H,9,10)
SMILES:CC(=O)C(C(C(=O)O)O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,3-Dihydroxy-4-oxopentanoic Acid
CAS:Controlled Product<p>Applications 2,3-Dihydroxy-4-oxopentanoic Acid is a secondary organic aerosol.<br>References Kleindienst, T., et al.: Atmospheric Environ., 41, 8288 (2007); Stone, E., et al.: Environ. Sci. Tech., 43, 3448 (2009)<br></p>Formula:C5H8O5Color and Shape:NeatMolecular weight:148.11
