CAS 37526-67-3

2-[(Trifluoromethyl)thio]benzoic acid

Description:

2-[(Trifluoromethyl)thio]benzoic acid, with the CAS number 37526-67-3, is an organic compound characterized by the presence of a benzoic acid moiety substituted with a trifluoromethylthio group. This compound features a sulfur atom bonded to a trifluoromethyl group (–CF3), which significantly influences its chemical properties, including its reactivity and polarity. The trifluoromethyl group is known for imparting strong electron-withdrawing characteristics, which can enhance the acidity of the carboxylic acid functional group. As a result, 2-[(Trifluoromethyl)thio]benzoic acid may exhibit increased solubility in polar solvents and can participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. Additionally, the presence of the sulfur atom can affect the compound's biological activity and potential applications in pharmaceuticals or agrochemicals. Overall, this compound is of interest in both synthetic organic chemistry and materials science due to its unique structural features and functional properties.

Formula: C₈H₅F₃O₂S

InChI: InChI=1S/C8H5F3O2S/c9-8(10,11)14-6-4-2-1-3-5(6)7(12)13/h1-4H,(H,12,13)

InChI key: InChIKey=KYCFVGRNHSGPBJ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(SC(F)(F)F)C=CC=C1

Synonyms:

• Benzoic acid, 2-[(trifluoromethyl)thio]-
• o-(Trifluoromethylthio)benzoic acid
• 2-(Trifluoromethylthio)benzoic acid
• 2-[(Trifluoromethyl)sulfanyl]benzoic acid
• 2-[(Trifluoromethyl)thio]benzoic acid

2-(Trifluoromethylthio)benzoic acid

CAS: 37526-67-3

Formula: C₈H₅F₃O₂S

Molecular weight: 222.1843

Ref: IN-DA00D39K

2-[(Trifluoromethyl)thio]benzoic acid

CAS: 37526-67-3

2-[(Trifluoromethyl)thio]benzoic acid

Formula: C₈H₅F₃O₂S

Purity: 98%

Color and Shape: white powder

Molecular weight: 222.18g/mol

Ref: 54-PC9435

2-((Trifluoromethyl)thio)benzoic acid

CAS: 37526-67-3

Versatile small molecule scaffold

Formula: C₈H₅F₃O₂S

Purity: Min. 95%

Molecular weight: 222.18 g/mol

Ref: 3D-MBA52667