
CAS 37535-49-2
:L-4-Pyridylalanine
Description:
L-4-Pyridylalanine, also known as L-4-pyridyl-α-alanine, is an amino acid derivative characterized by the presence of a pyridine ring attached to the α-carbon of the alanine structure. This compound features a chiral center, which contributes to its potential biological activity. It is typically a white to off-white crystalline solid and is soluble in water, making it suitable for various biochemical applications. The presence of the pyridine moiety may impart unique properties, such as the ability to participate in hydrogen bonding and interactions with biological receptors. L-4-Pyridylalanine is of interest in pharmaceutical research, particularly in the development of drugs targeting neurological disorders, as it may influence neurotransmitter systems. Its chemical structure allows for potential modifications, which can enhance its efficacy or selectivity in biological systems. As with many amino acid derivatives, it is important to handle L-4-Pyridylalanine with care, following appropriate safety protocols in laboratory settings.
Formula:C8H10N2O2
InChI:InChI=1/C8H10N2O2/c1-6(8(11)12)10-7-2-4-9-5-3-7/h2-6H,1H3,(H,9,10)(H,11,12)/t6-/m0/s1
SMILES:C[C@@H](C(=O)O)N=c1cc[nH]cc1
Synonyms:- L-3-(4-pyridyl)-alanine
- (2S)-2-ammonio-3-pyridin-4-ylpropanoate
- (S)-2-Amino-3-(4'-Pyridyl)Propanoic Acid
- (S)-2-Amino-3-(4-Pyridyl)Propionic Acid
- H-Ala(4-Pyri)-Oh
- H-Ala(4'-Pyridyl)-Oh
- 3-(4-Pyridyl)-Alanine
- 3-(4'-Pyridyl)-L-Alanine
- H-4-Pal-OH・2HCl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(S)-2-Amino-3-(pyridin-4-yl)propanoic acid
CAS:Formula:C8H10N2O2Purity:98%Color and Shape:SolidMolecular weight:166.1772(2S)-2-Amino-3-(pyridin-4-yl)propanoic acid
CAS:(2S)-2-Amino-3-(pyridin-4-yl)propanoic acidFormula:C8H10N2O2Purity:98%Color and Shape: white powderMolecular weight:166.18g/mol(S)-2-Amino-3-(pyridin-4-yl)propanoic acid
CAS:Formula:C8H10N2O2Purity:98%Color and Shape:SolidMolecular weight:166.183-(4'-Pyridyl)-L-alanine
CAS:<p>Please enquire for more information about 3-(4'-Pyridyl)-L-alanine including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C8H10N2O2Purity:Min. 95%Color and Shape:PowderMolecular weight:166.18 g/mol




