CAS 37535-51-6

H-.beta.-(2-Pyridyl)-Ala-OH

Description:

H-β-(2-Pyridyl)-Ala-OH, also known as a pyridylalanine derivative, is a chemical compound characterized by the presence of a pyridine ring and an alanine amino acid structure. This compound typically exhibits properties associated with both amino acids and heterocyclic aromatic compounds. It is likely to be a white to off-white solid, soluble in polar solvents such as water and methanol, due to the presence of the amino and hydroxyl functional groups. The pyridine moiety can contribute to its ability to participate in hydrogen bonding and coordination with metal ions, making it potentially useful in various biochemical applications. Additionally, the compound may exhibit biological activity, which could be of interest in medicinal chemistry and drug development. Its specific reactivity and interactions would depend on the functional groups present and the overall molecular structure, making it a subject of interest for further research in fields such as pharmacology and organic synthesis.

Formula: C₈H₁₀N₂O₂

InChI: InChI=1/C8H10N2O2/c9-7(8(11)12)5-6-3-1-2-4-10-6/h1-4,7H,5,9H2,(H,11,12)/t7-/m1/s1

SMILES: c1ccnc(c1)C[C@H](C(=O)O)N

Synonyms:

• L-2-Pyridylalanine
• 3-(2-Pyridyl)-L-alanine
• L-3-(2-Pyridyl)-Alanine
• 3-pyridin-2-yl-L-alanine
• (2R)-2-ammonio-3-pyridin-2-ylpropanoate

H-2-Pal-OH

CAS: 37535-51-6

Formula: C₈H₁₀N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 166.1772

Ref: IN-DA003BA3

3-(3-Pyridyl)-L-alanine hydrochloride

CAS: 37535-51-6

Ref: 7W-GM2202

3-(2-Pyridyl)-L-alanine

CAS: 37535-51-6

Molecular weight: 166.18

Ref: 7W-GM0409

3-(Pyridin-2-yl)-L-alanine

CAS: 37535-51-6

3-(Pyridin-2-yl)-L-alanine

Formula: C₈H₁₀N₂O₂

Purity: 98%

Color and Shape: white solid

Molecular weight: 166.18g/mol

Ref: 54-OR14721

3-(2-PYRIDYL)-L-ALANINE

CAS: 37535-51-6

Purity: 98%

Molecular weight: 166.18

Ref: 10-F819251

3-(2-Pyridyl)-L-alanine

CAS: 37535-51-6

3-(2-Pyridyl)-L-alanine is a metabolite of the amino acid L-phenylalanine. It is formed by the intramolecular addition of hydrogen to the aminomutases, and then converted to 3-(2-pyridyl)alanine by an aminomutase. The analogs of 3-(2-pyridyl)-L-alanine have been detected in various natural products, such as siderophores, antibiotics, and pigments. 3-(2-Pyridyl)-L-alanine can be synthesized using chromophore and hydrogen bond chemistry. This chemical is a substrate for chemoenzymatic synthesis.

Formula: C₈H₁₀N₂O₂

Purity: Min. 95%

Molecular weight: 166.18 g/mol

Ref: 3D-FP36824