
CAS 37535-52-7
:3-(2-Pyridyl)-D-alanine
Description:
3-(2-Pyridyl)-D-alanine, with the CAS number 37535-52-7, is an amino acid derivative characterized by the presence of a pyridine ring attached to the D-alanine structure. This compound features a chiral center, which contributes to its D-configuration, distinguishing it from its L-counterpart. The pyridine moiety imparts unique properties, such as increased solubility in polar solvents and potential interactions in biological systems, making it of interest in medicinal chemistry and drug design. The compound is typically a white to off-white solid and is soluble in water and organic solvents, depending on the pH. Its molecular structure allows for various applications, including serving as a building block in peptide synthesis and as a ligand in coordination chemistry. Additionally, the presence of the pyridine ring may enhance its ability to form hydrogen bonds and participate in π-π stacking interactions, which are crucial in biological and chemical processes. Overall, 3-(2-Pyridyl)-D-alanine is a versatile compound with significant implications in both research and application.
Formula:C8H10N2O2
InChI:InChI=1S/C8H10N2O2/c9-7(8(11)12)5-6-3-1-2-4-10-6/h1-4,7H,5,9H2,(H,11,12)/t7-/m1/s1
InChI key:PDRJLZDUOULRHE-SSDOTTSWSA-N
SMILES:C1=CC=NC(=C1)C[C@H](C(=O)O)N
Synonyms:- D-2-Pyridylalanine
- D-3-(2-Pyridyl)-Alanine
- H-.beta.-(2-Pyridyl)-D-Ala-OH
- H-D-2-Pal-OH・2HCl
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
(2R)-2-Amino-3-(pyridin-2-yl)propanoic acid
CAS:(2R)-2-Amino-3-(pyridin-2-yl)propanoic acidFormula:C8H10N2O2Purity:≥95%Color and Shape:Off-white Solid-PowderMolecular weight:166.17723-(2-Pyridyl)-D-alanine
CAS:Formula:C8H10N2O2Purity:98%Color and Shape:SolidMolecular weight:166.17723-(2-Pyridyl)-D-alanine
CAS:M03145 - 3-(2-Pyridyl)-D-alanine
Formula:C8H10N2O2Purity:98%Color and Shape:SolidMolecular weight:166.183-(2-Pyridyl)-D-alanine
CAS:3-(2-Pyridyl)-D-alanine is an amino acid that is a precursor to the peptide antibiotic, pyrithione. It can be prepared from 2-pyridylacetic acid and D-alanine. 3-(2-Pyridyl)-D-alanine is a chiral molecule with two stereogenic centres, which means it has four different optical isomers: L-, D-, S-, and R-. The L form of 3-(2-pyridyl)-D-alanine was found in Streptomyces sp. strain NRRL 8057. This amino acid is synthesized by a peptide synthetase enzyme. The sequence of this biosynthetic gene has not been determined yet.Formula:C8H10N2O2Purity:Min. 95%Molecular weight:166.18 g/mol





