CymitQuimica logo

CAS 37535-57-2

:

(S)-N-Boc-(4-Pyridyl)alanine

Description:
(S)-N-Boc-(4-Pyridyl)alanine is a chiral amino acid derivative characterized by the presence of a tert-butoxycarbonyl (Boc) protecting group on the amine, and a pyridine ring at the 4-position of the alanine side chain. This compound is typically used in peptide synthesis and medicinal chemistry due to its ability to introduce chirality and functional diversity into molecular structures. The Boc group serves as a protective moiety that can be removed under acidic conditions, allowing for further functionalization of the amino group. The pyridine ring contributes to the compound's polarity and can participate in various interactions, such as hydrogen bonding and coordination with metal ions. Additionally, the presence of the pyridine moiety may enhance the compound's solubility in organic solvents and its overall reactivity. Overall, (S)-N-Boc-(4-Pyridyl)alanine is a valuable building block in the synthesis of biologically active compounds and can be utilized in the development of pharmaceuticals and agrochemicals.
Formula:C13H18N2O4
InChI:InChI=1/C13H18N2O4/c1-13(2,3)19-12(18)15-10(11(16)17)8-9-4-6-14-7-5-9/h4-7,10H,8H2,1-3H3,(H,15,18)(H,16,17)/t10-/m0/s1
InChI key:FNYWDMKESUACOU-JTQLQIEISA-N
SMILES:CC(C)(C)OC(=N[C@@H](Cc1ccncc1)C(=O)O)O
Synonyms:
  • Boc-L-4-Pyridylalanine
  • Boc-L-3-(4-Pyridyl)-alanine
  • Boc-3-(4-Pyridyl)-L-alanine
  • Boc-4-Pal-OH
  • Boc-Ala(4-pyridyl)-OH
Found 4 products.