CAS 3757-53-7

5-methyl-1H-pyrrole-2-carboxylic acid

Description:

5-Methyl-1H-pyrrole-2-carboxylic acid is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features a carboxylic acid functional group (-COOH) at the 2-position and a methyl group (-CH3) at the 5-position of the pyrrole ring. It is typically a white to off-white solid and is soluble in polar solvents due to the presence of the carboxylic acid group. The compound is of interest in various fields, including medicinal chemistry and organic synthesis, due to its potential biological activities and applications in the development of pharmaceuticals. Its molecular structure allows for various chemical reactions, including esterification and amidation, making it a versatile building block in organic synthesis. Additionally, the presence of the methyl group can influence the compound's reactivity and stability, as well as its interactions with biological targets. Overall, 5-methyl-1H-pyrrole-2-carboxylic acid is a significant compound in the study of nitrogen-containing heterocycles.

Formula: C₆H₇NO₂

InChI: InChI=1/C6H7NO2/c1-4-2-3-5(7-4)6(8)9/h2-3,7H,1H3,(H,8,9)

SMILES: Cc1ccc(C(=O)O)[nH]1

Synonyms:

• 3757-53-7

5-METHYL-1H-PYRROLE-2-CARBOXYLIC ACID

CAS: 3757-53-7

Formula: C₆H₇NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 125.1253

Ref: IN-DA0037K7

5-Methyl-1H-pyrrole-2-carboxylic acid

CAS: 3757-53-7

5-Methyl-1H-pyrrole-2-carboxylic acid is a useful life science reagent for biochemical experiments and organic synthesis.

Formula: C₆H₇NO₂

Color and Shape: Solid

Molecular weight: 125.13

Ref: TM-TN9810

5-Methyl-1H-pyrrole-2-carboxylic acid

CAS: 3757-53-7

5-Methyl-1H-pyrrole-2-carboxylic acid

Purity: 98%

Molecular weight: 125.13g/mol

Ref: 54-OR962602

5-Methyl-1H-pyrrole-2-carboxylic acid

CAS: 3757-53-7

Formula: C₆H₇NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 125.127

Ref: 10-F220536