
CAS 37577-75-6
:12-Hydroxy-9-[3-hydroxy-3-(2-hydroxyphenyl)-1-oxo-2-propen-1-yl]-10,11-dimethoxy-3-(methoxycarbonyl)-1-oxo-1H-anthra[2,3-c]pyran-8-acetic acid
Description:
12-Hydroxy-9-[3-hydroxy-3-(2-hydroxyphenyl)-1-oxo-2-propen-1-yl]-10,11-dimethoxy-3-(methoxycarbonyl)-1-oxo-1H-anthra[2,3-c]pyran-8-acetic acid, with the CAS number 37577-75-6, is a complex organic compound characterized by its anthraquinone structure, which is known for its diverse biological activities. This compound features multiple functional groups, including hydroxyl, methoxy, and carboxylic acid groups, contributing to its solubility and reactivity. The presence of the anthraquinone moiety often imparts significant color properties, making it useful in dyes and pigments. Additionally, the compound's structure suggests potential applications in pharmaceuticals, particularly due to its ability to interact with biological systems. Its intricate arrangement of substituents may also influence its antioxidant and anti-inflammatory properties. As with many organic compounds, the specific characteristics such as melting point, solubility, and spectral properties would depend on the purity and specific conditions under which the compound is studied. Overall, this compound exemplifies the complexity and utility of organic molecules in various scientific fields.
Formula:C32H24O12
InChI:InChI=1S/C32H24O12/c1-41-29-24(21(35)13-20(34)18-6-4-5-7-19(18)33)17(12-23(36)37)10-15-8-14-9-16-11-22(31(39)43-3)44-32(40)26(16)28(38)25(14)30(42-2)27(15)29/h4-11,13,33-34,38H,12H2,1-3H3,(H,36,37)
InChI key:InChIKey=GGEDVBUCHDZLTH-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=CC3=C1C(O)=C4C(=C3)C=C(C(OC)=O)OC4=O)C=C(CC(O)=O)C(C(C=C(O)C5=C(O)C=CC=C5)=O)=C2OC
Synonyms:- Thermorubin
- 1H-Anthra[2,3-c]pyran-8-acetic acid, 12-hydroxy-9-[3-hydroxy-3-(2-hydroxyphenyl)-1-oxo-2-propen-1-yl]-10,11-dimethoxy-3-(methoxycarbonyl)-1-oxo-
- 12-Hydroxy-9-[3-hydroxy-3-(2-hydroxyphenyl)-1-oxo-2-propen-1-yl]-10,11-dimethoxy-3-(methoxycarbonyl)-1-oxo-1H-anthra[2,3-c]pyran-8-acetic acid
- 1H-Anthra[2,3-c]pyran-8-acetic acid, 12-hydroxy-9-[3-hydroxy-3-(2-hydroxyphenyl)-1-oxo-2-propenyl]-10,11-dimethoxy-3-(methoxycarbonyl)-1-oxo-
- Thermorubin A
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Thermorubin
CAS:Thermorubin is a natural compound that inhibits protein synthesis and RNA synthesis. Thermorubin is a methyltransferase inhibitor, which prevents the conversion of s-adenosylhomocysteine to adenosine triphosphate, leading to cell death by inhibiting protein synthesis and RNA synthesis. Thermorubin has been shown to be effective against viruses such as influenza A and mouse melanoma cells. In addition, this compound can inhibit the growth of intestinal bacteria and may be used in the treatment of gastrointestinal infections. Thermorubin is also active against thermophilic bacteria and can be used for the treatment of wounds infected with these bacteria. The shikimate pathway is inhibited by thermorubin, which leads to inhibition of polyethylene glycols.Formula:C32H24O12Purity:Min. 95%Molecular weight:600.5 g/mol

