CAS 3758-70-1
:1-(4-Nitrophenyl)-1-propanone
Description:
1-(4-Nitrophenyl)-1-propanone, also known as p-nitroacetophenone, is an organic compound characterized by its ketone functional group and a nitrophenyl substituent. It typically appears as a yellow crystalline solid and is known for its aromatic properties due to the presence of the nitrophenyl group. The compound has a molecular formula that reflects its structure, consisting of a propanone backbone with a para-nitro group attached to the phenyl ring. It is moderately soluble in organic solvents such as ethanol and acetone but has limited solubility in water. This compound is often used in organic synthesis, particularly in the preparation of various derivatives and as an intermediate in the production of dyes and pharmaceuticals. Its reactivity is influenced by the electron-withdrawing nitro group, which can affect electrophilic aromatic substitution reactions. Safety precautions should be taken when handling this compound, as it may pose health risks, including potential toxicity and irritant effects.
Formula:C9H9NO3
InChI:InChI=1S/C9H9NO3/c1-2-9(11)7-3-5-8(6-4-7)10(12)13/h3-6H,2H2,1H3
InChI key:InChIKey=QHTSEJJUUBOESF-UHFFFAOYSA-N
SMILES:C(CC)(=O)C1=CC=C(N(=O)=O)C=C1
Synonyms:- 1-(4-Nitrophenyl)-1-propanone
- 1-Propanone, 1-(4-Nitrophenyl)-
- 4-Nitropropiophenone
- NSC 582
- Propiophenone, 4′-nitro-
- p-Nitropropiophenone
- 1-(4-NITROPHENYL)PROPAN-1-ONE
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-Nitropropiophenone
CAS:<p>4-Nitropropiophenone is an enantiomer of the hydrolysis product of escola. It has been shown to be optically active and undergoes hydrolysis reactions that are catalyzed by acid and enzymes. Hydrolysis is a process in which a chemical compound is broken down by the addition of water or other solvents. The cleavage reaction can be reversed by the addition of heat or base. Cleavage reactions are used to produce chiral molecules that are not naturally present in nature. Chiral molecules have a non-superimposable mirror image form each other, such as left and right hands. 4-Nitropropiophenone is hydrolyzed by chloramphenicol, an input molecule, to form 1-chloro-4-nitrophenol and 2-hydroxyacetophenone, which then undergoes a transformation reaction with esters to form 3-methylbenzoic acid methyl ester and 3-methyl</p>Formula:C9H9NO3Purity:Min. 95%Color and Shape:White PowderMolecular weight:179.17 g/mol

