CAS 375853-85-3

tert-butyl (3-bromo-4-fluorobenzyl)carbamate

Description:

Tert-butyl (3-bromo-4-fluorobenzyl)carbamate is an organic compound characterized by its carbamate functional group, which is derived from the reaction of an amine with a carbonic acid derivative. This compound features a tert-butyl group, providing steric hindrance and enhancing its lipophilicity, which can influence its solubility and reactivity. The presence of the bromine and fluorine substituents on the benzyl moiety introduces unique electronic properties, potentially affecting the compound's reactivity and interaction with biological targets. The bromine atom can serve as a leaving group in nucleophilic substitution reactions, while the fluorine atom may enhance the compound's metabolic stability. Tert-butyl (3-bromo-4-fluorobenzyl)carbamate is often utilized in medicinal chemistry and drug development due to its potential as a building block for more complex molecules. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Safety data and handling precautions should be observed, as with any chemical substance.

Formula: C₁₂H₁₅BrFNO₂

InChI: InChI=1/C12H15BrFNO2/c1-12(2,3)17-11(16)15-7-8-4-5-10(14)9(13)6-8/h4-6H,7H2,1-3H3,(H,15,16)

SMILES: CC(C)(C)OC(=NCc1ccc(c(c1)Br)F)O

Synonyms:

• [(3-Bromo-4-fluorophenyl)methyl]-carbamic acid tert-butyl ester

tert-Butyl 3-bromo-4-fluorobenzylcarbamate

CAS: 375853-85-3

tert-Butyl 3-bromo-4-fluorobenzylcarbamate

Purity: 97%

Molecular weight: 304.16g/mol

Ref: 54-PC100697

tert-Butyl 3-bromo-4-fluorobenzylcarbamate

CAS: 375853-85-3

Purity: 97%

Molecular weight: 304.159

Ref: 10-F983051