CymitQuimica logo

CAS 375857-80-0

:

Imidazo[1,2-a]pyrimidine-7-carboxaldehyde

Description:
Imidazo[1,2-a]pyrimidine-7-carboxaldehyde is a heterocyclic organic compound characterized by its fused imidazole and pyrimidine rings, which contribute to its unique chemical properties. This compound features a carboxaldehyde functional group, which is known for its reactivity and ability to participate in various chemical reactions, including condensation and oxidation. The presence of nitrogen atoms in the ring structure enhances its potential for forming coordination complexes with metals and interacting with biological targets, making it of interest in medicinal chemistry and drug development. Imidazo[1,2-a]pyrimidine derivatives are often studied for their pharmacological activities, including antimicrobial and anticancer properties. The compound's molecular structure allows for diverse substitution patterns, which can further modify its biological activity and solubility. Additionally, its relatively low molecular weight and specific functional groups make it suitable for various synthetic applications in organic chemistry. Overall, Imidazo[1,2-a]pyrimidine-7-carboxaldehyde represents a versatile scaffold for the development of novel therapeutic agents.
Formula:C7H5N3O
InChI:InChI=1S/C7H5N3O/c11-5-6-1-3-10-4-2-8-7(10)9-6/h1-5H
InChI key:NOWRGSYRDSGFHT-UHFFFAOYSA-N
SMILES:C1=CN2C=CN=C2N=C1C=O
Synonyms:
  • Imidazo[1,2-A]Pyrimidine-7-Carbaldehyde
  • Imidazo[1,2-a]pyrimidine-7-carboxaldehyde (9CI)
Found 4 products.