CAS 376-50-1

1,6-Diethyl 2,2,3,3,4,4,5,5-octafluorohexanedioate

Description:

1,6-Diethyl 2,2,3,3,4,4,5,5-octafluorohexanedioate, with CAS number 376-50-1, is a fluorinated organic compound characterized by its unique structure that includes multiple ethyl groups and fluorinated carbon chains. This compound features a hexanedioate backbone, which contributes to its potential applications in various chemical processes. The presence of eight fluorine atoms significantly enhances its chemical stability and hydrophobic properties, making it resistant to degradation and useful in applications requiring chemical inertness. Additionally, the diethyl groups provide solubility in organic solvents, which can be advantageous in synthesis and formulation processes. The compound's fluorinated nature may also impart unique surface properties, making it of interest in materials science, particularly in the development of coatings and surfactants. Overall, 1,6-Diethyl 2,2,3,3,4,4,5,5-octafluorohexanedioate exemplifies the intriguing characteristics of fluorinated compounds, combining stability, solubility, and potential utility in various industrial applications.

Formula: C₁₀H₁₀F₈O₄

InChI: InChI=1S/C10H10F8O4/c1-3-21-5(19)7(11,12)9(15,16)10(17,18)8(13,14)6(20)22-4-2/h3-4H2,1-2H3

InChI key: InChIKey=UBMQHNSEGKYMTP-UHFFFAOYSA-N

SMILES: C(C(C(C(OCC)=O)(F)F)(F)F)(C(C(OCC)=O)(F)F)(F)F

Synonyms:

• 1,6-Diethyl 2,2,3,3,4,4,5,5-octafluorohexanedioate
• Diethyl Octafluorohexanedioate
• Diethyl octafluoroadipate
• Hexanedioic acid, 2,2,3,3,4,4,5,5-octafluoro-, 1,6-diethyl ester
• Hexanedioic acid, octafluoro-, diethyl ester
• Diethyl perfluoroadipate