CAS 376-77-2
:Perfluorocyclopentane
Description:
Perfluorocyclopentane (CAS 376-77-2) is a fully fluorinated cyclic hydrocarbon, characterized by its unique structure where all hydrogen atoms in cyclopentane are replaced by fluorine atoms. This compound is a colorless, odorless liquid at room temperature and exhibits high thermal and chemical stability due to the strong carbon-fluorine bonds. It has a low surface tension and is non-flammable, making it suitable for various applications, including as a solvent and in specialty chemical processes. Perfluorocyclopentane is also notable for its low global warming potential compared to other fluorinated compounds, which has garnered interest in environmental applications. Its high density and low viscosity contribute to its utility in specific industrial applications, including as a refrigerant and in electronic cooling systems. However, like many perfluorinated compounds, it is persistent in the environment and may pose ecological risks, prompting ongoing research into its environmental impact and potential alternatives.
Formula:C5F10
InChI:InChI=1S/C5F10/c6-1(7)2(8,9)4(12,13)5(14,15)3(1,10)11
InChI key:InChIKey=PWMJXZJISGDARB-UHFFFAOYSA-N
SMILES:FC1(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F
Synonyms:- 1,1,2,2,3,3,4,4,5,5-Decafluorocyclopentane
- Cyclopentane, 1,1,2,2,3,3,4,4,5,5-decafluoro-
- Cyclopentane, decafluoro-
- Perfluorocyclopentane
- Decafluorocyclopentane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Perfluorocyclopentane
CAS:<p>Perfluorocyclopentane</p>Purity:≥95%Color and Shape:LiquidMolecular weight:250.04g/mol1,1,2,2,3,3,4,4,5,5-Decafluorocyclopentane
CAS:Controlled Product<p>1,1,2,2,3,3,4,4,5,5-Decafluorocyclopentane is a fluorocarbon liquid with a boiling point of -50°C. It has an average particle diameter of 0.1 nm and a water vapor pressure of 1.6 × 10-10 torr at 20°C. Due to its non-polarity and low viscosity (1 cP), it can be used as a solvent in organic chemistry reactions. 1,1,2,2,3,3,4,4,5,5-Decafluorocyclopentane has been shown to be reactive at the target site due to its acid molecules that provide the reactive sites for this molecule's phase transition temperature (-52°C) and nmr spectra. The reactive sites also allow for x-ray structures to be obtained by imaging techniques such as electron microscopy or atomic force microscopy.</p>Formula:C5F10Purity:Min. 95%Molecular weight:250.04 g/mol

