CAS 376-90-9
:2,2,3,3,4,4-Hexafluoro-1,5-pentanediol
Description:
2,2,3,3,4,4-Hexafluoro-1,5-pentanediol is a fluorinated organic compound characterized by its six fluorine atoms attached to a pentanediol backbone. This compound is notable for its high degree of fluorination, which imparts unique properties such as increased hydrophobicity and thermal stability. It typically appears as a colorless liquid or solid, depending on temperature, and is soluble in organic solvents. The presence of hydroxyl (-OH) groups contributes to its potential reactivity, allowing for hydrogen bonding and interactions with other polar substances. Due to its fluorinated nature, it exhibits low surface tension and is resistant to degradation, making it of interest in various applications, including specialty chemicals and materials science. Additionally, its unique structure may influence its behavior in biological systems and environmental contexts, necessitating careful handling and assessment of its safety profile. Overall, 2,2,3,3,4,4-Hexafluoro-1,5-pentanediol is a compound of interest in both industrial and research settings due to its distinctive chemical characteristics.
Formula:C5H6F6O2
InChI:InChI=1S/C5H6F6O2/c6-3(7,1-12)5(10,11)4(8,9)2-13/h12-13H,1-2H2
InChI key:InChIKey=IELVMUPSWDZWSD-UHFFFAOYSA-N
SMILES:C(C(CO)(F)F)(C(CO)(F)F)(F)F
Synonyms:- 1,5-Pentanediol, 2,2,3,3,4,4-hexafluoro-
- 2,2,3,3,4,4-Hexafluoro-1,5-pentanediol
- 2,2,3,3,4,4-Hexafluoropentanediol
- Hexafluoroamylene glycol
- Nsc 29196
- 1,1,2,2,3,3-Hexafluoropentane-1,5-Diol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2,2,3,3,4,4-Hexafluoro-1,5-pentanediol
CAS:Formula:C5H6F6O2Purity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:212.092,2,3,3,4,4-Hexafluoro-1,5-pentanediol
CAS:Controlled Product2,2,3,3,4,4-Hexafluoro-1,5-pentanediol is a colorless liquid with a boiling point of 155°C. It is soluble in water and has an odor similar to that of hexane. 2,2,3,3,4,4-Hexafluoro-1,5-pentanediol is used as a chemical intermediate for the production of sodium salts and quaternary ammonium compounds. This substance can be obtained by reacting butanediol with hydrofluoric acid or trifluoromethanesulfonic acid. The most common use of 2,2,3,3,4,4-hexafluoro-1,5-pentanediol is in the synthesis of amines. It also has been used as a solvent for electroplating metals and as a high boiling point solvent in organic reactions. This compound exhibits nucleophilic properties with amines and canFormula:C5H6F6O2Purity:Min. 95%Molecular weight:212.09 g/mol2,2,3,3,4,4-HEXAFLUORO-1,5-PENTANEDIOL
CAS:Formula:C5H6F6O2Purity:98%Color and Shape:SolidMolecular weight:212.0904


