CAS 3760-20-1
:2-Ethylcyclohexanol
Description:
2-Ethylcyclohexanol is a cyclic alcohol characterized by its six-membered cyclohexane ring with an ethyl group and a hydroxyl (-OH) group attached to the second carbon atom. This compound is a colorless liquid at room temperature and possesses a distinctive odor. It is soluble in organic solvents and exhibits limited solubility in water due to its hydrophobic cyclohexane structure. The presence of the hydroxyl group imparts polar characteristics, allowing for hydrogen bonding, which influences its physical properties such as boiling and melting points. 2-Ethylcyclohexanol is primarily used as an intermediate in organic synthesis and can serve as a solvent or plasticizer in various industrial applications. Its chemical reactivity includes typical alcohol reactions, such as dehydration and oxidation, making it a versatile compound in synthetic chemistry. Safety considerations include handling it in well-ventilated areas and using appropriate personal protective equipment, as it may cause irritation upon contact with skin or eyes.
Formula:C8H16O
InChI:InChI=1S/C8H16O/c1-2-7-5-3-4-6-8(7)9/h7-9H,2-6H2,1H3
InChI key:InChIKey=CFYUBZHJDXXXQE-UHFFFAOYSA-N
SMILES:C(C)C1C(O)CCCC1
Synonyms:- Cyclohexanol, 2-ethyl-
- 2-Ethylcyclohexan-1-ol
- 2-Ethylcyclohexanol
- NSC 62035
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Ethylcyclohexanol (cis- and trans- mixture)
CAS:Formula:C8H16OPurity:>97.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:128.222-Ethylcyclohexanol (cis- and trans- mixture)
CAS:2-Ethylcyclohexanol is a hydrogen peroxide catalyst that has been implemented in nanocomposites for use as electrodes. This multifunctional material is a transition metal oxide with properties of being acidic and able to catalyze the oxidation of organic pollutants. 2-Ethylcyclohexanol has also been shown to be efficient in mineralizing (oxidizing) transition metals such as Fe(II) or Cr(III). This chemical can be used to remove toxic heavy metals from water, and it can be analyzed using techniques such as voltammetry, cyclic voltammetry, and electrochemical impedance spectroscopy. 2-Ethylcyclohexanol can be used as an inexpensive hydroxyl radical generator. It is commercially available in the cis- and trans- mixture.Formula:C8H16OPurity:Min. 95%Molecular weight:128.22 g/mol




