CymitQuimica logo

CAS 37617-33-7

:

Cyclopentanol, 2,2-dimethyl-

Description:
Cyclopentanol, 2,2-dimethyl- is an organic compound characterized by its cyclopentane ring structure with two methyl groups attached to the second carbon atom. This compound is a colorless liquid at room temperature and possesses a distinct alcohol functional group (-OH), which contributes to its solubility in polar solvents like water. The presence of the cyclopentane ring imparts unique steric and electronic properties, influencing its reactivity and interactions with other molecules. It typically exhibits moderate volatility and a relatively low boiling point compared to larger alcohols. The compound is often used in organic synthesis and may serve as an intermediate in the production of various chemicals. Additionally, its structural features can lead to interesting conformational isomerism, affecting its physical properties. Safety data indicates that, like many alcohols, it should be handled with care due to potential flammability and health risks upon exposure. Overall, 2,2-dimethylcyclopentanol is a notable compound in organic chemistry with applications in research and industry.
Formula:C7H14O
InChI:InChI=1S/C7H14O/c1-7(2)5-3-4-6(7)8/h6,8H,3-5H2,1-2H3
InChI key:HHZBHIQGEGSCJF-UHFFFAOYSA-N
SMILES:CC1(CCCC1O)C
Synonyms:
  • 2,2-Dimethylcyclopentanol
Found 4 products.