CAS 37630-20-9
:2,3-Dimethoxy-w-nitrostyrene
Description:
2,3-Dimethoxy-w-nitrostyrene, identified by its CAS number 37630-20-9, is an organic compound characterized by its structure, which includes a styrene backbone substituted with two methoxy groups and a nitro group. This compound typically exhibits a yellow to orange color and is known for its aromatic properties due to the presence of the styrene moiety. The methoxy groups contribute to its electron-donating characteristics, which can influence its reactivity and solubility in various solvents. The nitro group, being an electron-withdrawing substituent, can enhance the compound's electrophilic reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, 2,3-Dimethoxy-w-nitrostyrene may exhibit interesting optical properties, making it a candidate for applications in organic electronics or as a precursor in the synthesis of more complex organic molecules. As with many nitro compounds, it is essential to handle this substance with care due to potential toxicity and environmental concerns.
Formula:C10H11NO4
InChI:InChI=1/C10H11NO4/c1-14-9-5-3-4-8(10(9)15-2)6-7-11(12)13/h3-7H,1-2H3
SMILES:COc1cccc(C=CN(=O)=O)c1OC
Synonyms:- 1,2-Dimethoxy-3-(2-Nitroethenyl)Benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
