CymitQuimica logo

CAS 376348-71-9

:

(1S)-3-{3-[3-methyl-5-(1-methylethyl)-4H-1,2,4-triazol-4-yl]-8-azabicyclo[3.2.1]oct-8-yl}-1-phenylpropan-1-amine

Description:
The chemical substance with the name "(1S)-3-{3-[3-methyl-5-(1-methylethyl)-4H-1,2,4-triazol-4-yl]-8-azabicyclo[3.2.1]oct-8-yl}-1-phenylpropan-1-amine" and CAS number "376348-71-9" is a complex organic compound characterized by its unique bicyclic structure and the presence of a triazole moiety. This compound features a chiral center, indicated by the (1S) configuration, which contributes to its potential biological activity and specificity in interactions with biological targets. The presence of a phenyl group and a propan-1-amine chain suggests that it may exhibit properties relevant to pharmacology, possibly acting as a ligand or modulator in various biochemical pathways. Its structural complexity, including multiple functional groups and stereochemistry, may influence its solubility, stability, and reactivity. Such compounds are often investigated for their potential therapeutic applications, particularly in fields like medicinal chemistry and drug development, where understanding their characteristics is crucial for assessing efficacy and safety profiles.
Formula:C22H33N5
InChI:InChI=1/C22H33N5/c1-15(2)22-25-24-16(3)27(22)20-13-18-9-10-19(14-20)26(18)12-11-21(23)17-7-5-4-6-8-17/h4-8,15,18-21H,9-14,23H2,1-3H3/t18?,19?,20?,21-/m0/s1
SMILES:CC(C)c1nnc(C)n1C1CC2CCC(C1)N2CC[C@@H](c1ccccc1)N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.