CAS 37656-48-7

4-(4-Fluorophenyl)piperidine

Description:

4-(4-Fluorophenyl)piperidine, with the CAS number 37656-48-7, is an organic compound characterized by its piperidine ring substituted with a para-fluorophenyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its form and purity. It possesses a molecular formula that reflects its structure, indicating the presence of both carbon and nitrogen atoms, along with fluorine. The fluorine atom enhances the compound's lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry and drug development. 4-(4-Fluorophenyl)piperidine may exhibit various pharmacological properties, potentially acting as a ligand for certain receptors in the central nervous system. Its synthesis often involves standard organic reactions, and it can be analyzed using techniques such as NMR and mass spectrometry to confirm its structure and purity. Safety data should be consulted to handle this compound appropriately, as with any chemical substance, due to potential health hazards associated with its use.

Formula: C₁₁H₁₄FN

InChI: InChI=1/C11H14FN/c12-11-3-1-9(2-4-11)10-5-7-13-8-6-10/h1-4,10,13H,5-8H2

SMILES: c1cc(ccc1C1CCNCC1)F

Synonyms:

• Piperidine, 4-(4-Fluorophenyl)-

4-(4-Fluorophenyl)piperidine

CAS: 37656-48-7

Formula: C₁₁H₁₄FN

Purity: 97%

Color and Shape: Liquid

Molecular weight: 179.2340

Ref: IN-DA0078EU

4-(4-Fluoro-phenyl)-piperidine

CAS: 37656-48-7

4-(4-Fluoro-phenyl)-piperidine

Purity: 97%

Molecular weight: 179.23g/mol

Ref: 54-PC430522

4-(4-Fluorophenyl)piperidine

CAS: 37656-48-7

Formula: C₁₁H₁₄FN

Purity: >98.0%(GC)

Color and Shape: Colorless to Yellow clear liquid

Molecular weight: 179.24

Ref: 3B-F1333

4-(4-Fluoro-phenyl)-piperidine

CAS: 37656-48-7

Formula: C₁₁H₁₄FN

Purity: 97%

Color and Shape: Solid

Molecular weight: 179.238

Ref: 10-F036160