CAS 376584-63-3

1H-pyrazol-3-yl boronic acid

Description:

1H-pyrazol-3-yl boronic acid is an organoboron compound characterized by the presence of a pyrazole ring and a boronic acid functional group. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents such as water and alcohols, which is a common trait of boronic acids due to their ability to form hydrogen bonds. The boronic acid moiety allows for the formation of reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. It can participate in Suzuki-Miyaura cross-coupling reactions, facilitating the formation of carbon-carbon bonds. Additionally, the pyrazole ring contributes to the compound's potential biological activity, as pyrazole derivatives are often explored for their pharmacological properties. The compound's reactivity and functional versatility make it a valuable intermediate in the synthesis of more complex molecules. Proper handling and storage are essential due to its sensitivity to moisture and air, which can affect its stability and reactivity.

Formula: C₃H₄BBrN₂O₂

InChI: InChI=1/C3H4BBrN2O2/c5-7-3(4(8)9)1-2-6-7/h1-2,8-9H

SMILES: c1cnn(c1B(O)O)Br

Synonyms:

• Pyrazole-3-boronic acid
• Pyrazole-2-Boronic Acid
• 1H-pyrazol-3-ylboronic acid
• 1H-Pyrazole-5-boronic acid
• 1H-Pyrazole-3-boronic acid

1H-Pyrazole-3-boronic acid hydrate, 95%

CAS: 376584-63-3

Significantly used as synthetic intermediates. They are widely used in the production of optics. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar pro

Formula: C₃H₅BN₂O₂

Purity: 95%

Color and Shape: White, Powder

Molecular weight: 111.90

Ref: 02-H27286

(1H-Pyrazol-3-yl)boronic acid

CAS: 376584-63-3

Formula: C₃H₅BN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 111.8950

Ref: IN-DA003U1W

1H-Pyrazole-5-boronic acid

CAS: 376584-63-3

1H-Pyrazole-5-boronic acid

Formula: C₃H₅BN₂O₂

Purity: tech

Color and Shape: faint orange to brown solid

Molecular weight: 111.90g/mol

Ref: 54-OR8413

1H-Pyrazol-3-ylboronic acid

CAS: 376584-63-3

Formula: C₃H₅BN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 111.9

Ref: 10-F047096