CAS 3766-55-0
:4-Allylthiosemicarbazide
Description:
4-Allylthiosemicarbazide is an organic compound characterized by its thiosemicarbazide structure, which includes an allyl group. It typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols. The compound features a thiosemicarbazide functional group, which is known for its ability to form coordination complexes with various metal ions, making it of interest in coordination chemistry and potential applications in medicinal chemistry. Its reactivity is influenced by the presence of both the thioamide and the allyl substituent, allowing for various chemical transformations. Additionally, 4-Allylthiosemicarbazide may exhibit biological activity, including antimicrobial or antitumor properties, although specific biological effects can vary based on the context of use and the presence of other functional groups. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C4H9N3S
InChI:InChI=1S/C4H9N3S/c1-2-3-6-4(8)7-5/h2H,1,3,5H2,(H2,6,7,8)
InChI key:InChIKey=CZLPCLANGIXFIE-UHFFFAOYSA-N
SMILES:C(NCC=C)(NN)=S
Synonyms:- 1-Amino-3-(prop-2-en-1-yl)thiourea
- 1-Amino-3-prop-2-enylthiourea
- 4-(2-Propenyl)hydrazinethiocarbamide
- 4-Allyl-3-thiosemicarbazide
- 4-Propenylthiosemicarbazide
- Allylthiosemicarbazide
- Hydrazinecarbothioamide, N-2-propen-1-yl-
- Hydrazinecarbothioamide, N-2-propenyl-
- N-(2-Propenyl)hydrazinecarbothioamide
- N-(prop-2-en-1-yl)hydrazinecarbothioamide
- N-2-Propen-1-ylhydrazinecarbothioamide
- N-Allylthiosemicarbazide
- NSC 75830
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Hydrazinecarbothioamide, N-2-propenyl-
CAS:Formula:C4H9N3SPurity:98%Color and Shape:SolidMolecular weight:131.19944-Allyl-3-thiosemicarbazide
CAS:4-Allyl-3-thiosemicarbazidePurity:≥95%Color and Shape:SolidMolecular weight:131.20g/mol4-Allyl-3-Thiosemicarbazide
CAS:Controlled Product<p>Stability hygroscopic<br>Applications 4-Allyl-3-Thiosemicarbazide (cas# 3766-55-0) is a useful research chemical.<br></p>Formula:C4H9N3SColor and Shape:NeatMolecular weight:131.24-Allyl-3-thiosemicarbazide
CAS:<p>4-Allyl-3-thiosemicarbazide is a copper complex that inhibits the growth of cancer cells. Copper chloride is an important catalyst for this reaction. The coordination geometry of the copper ion and the structure of the product are key factors in determining its cytotoxicity. This compound has been shown to have significant cytotoxicity against a variety of cancer cell lines, including leukemia, lymphoma, breast, prostate, lung, pancreatic and colon cancer cells. 4-Allyl-3-thiosemicarbazide is also able to inhibit kinesin by binding to its ATPase site and preventing it from transporting cargo along microtubules.</p>Formula:C4H9N3SPurity:Min. 95%Molecular weight:131.2 g/mol




