CAS 376608-66-1
:(2E)-3-(3,4-Difluorophenyl)-2-propenoyl chloride
Description:
(2E)-3-(3,4-Difluorophenyl)-2-propenoyl chloride, with the CAS number 376608-66-1, is an organic compound characterized by its propenoyl chloride functional group and a difluorophenyl substituent. This compound features a double bond between the second and third carbon atoms of the propenoyl moiety, indicating its E configuration, which refers to the trans arrangement of substituents around the double bond. The presence of the difluorophenyl group enhances its reactivity and may influence its physical properties, such as solubility and boiling point. As an acyl chloride, it is expected to be a reactive species, particularly with nucleophiles, making it useful in various synthetic applications, including the formation of esters and amides. The difluorination introduces unique electronic properties, potentially affecting its reactivity and interactions in chemical reactions. Safety precautions should be taken when handling this compound, as acyl chlorides can be corrosive and may release harmful gases upon reaction with water or moisture.
Formula:C9H5ClF2O
InChI:InChI=1S/C9H5ClF2O/c10-9(13)4-2-6-1-3-7(11)8(12)5-6/h1-5H/b4-2+
InChI key:InChIKey=HLVDWMSYSIMRNI-DUXPYHPUSA-N
SMILES:C(=C/C(Cl)=O)\C1=CC(F)=C(F)C=C1
Synonyms:- 2-Propenoyl chloride, 3-(3,4-difluorophenyl)-, (2E)-
- (E)-3-(3,4-Difluorophenyl)acryloyl chloride
- (2E)-3-(3,4-Difluorophenyl)-2-propenoyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
