CAS 37664-35-0

1-(4-bromophenyl)-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethanone

Description:

1-(4-bromophenyl)-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethanone, with the CAS number 37664-35-0, is a chemical compound characterized by its unique structural features. It contains a bromophenyl group, which contributes to its aromatic properties and potential reactivity. The presence of a triazole ring, specifically a 5-methyl-1H-1,2,4-triazole, indicates that this compound may exhibit biological activity, as triazoles are often found in pharmaceuticals and agrochemicals. The sulfanyl (thioether) functional group enhances its chemical reactivity and may influence its solubility and interaction with biological targets. This compound is likely to be a solid at room temperature, with potential applications in medicinal chemistry or as a research tool in various fields. Its specific properties, such as melting point, solubility, and reactivity, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound represents a blend of aromatic, heterocyclic, and functionalized characteristics that could be of interest in various chemical research applications.

Formula: C₁₁H₁₀BrN₃OS

InChI: InChI=1/C11H10BrN3OS/c1-7-13-11(15-14-7)17-6-10(16)8-2-4-9(12)5-3-8/h2-5H,6H2,1H3,(H,13,14,15)

SMILES: Cc1nc(n[nH]1)SCC(=O)c1ccc(cc1)Br

Synonyms:

• ethanone, 1-(4-bromophenyl)-2-[(5-methyl-4H-1,2,4-triazol-3-yl)thio]-

1-(4-bromophenyl)-2-[(5-methyl-4H-1,2,4-triazol-3-yl)thio]ethanone

CAS: 37664-35-0

Formula: C₁₁H₁₀BrN₃OS

Purity: 95.0%

Molecular weight: 312.19

Ref: 10-F314872