CAS 376646-58-1
:Tryptophan, N-(1H-indol-3-ylacetyl)-
Description:
Tryptophan, N-(1H-indol-3-ylacetyl)-, also known by its CAS number 376646-58-1, is a derivative of the essential amino acid tryptophan, which plays a crucial role in protein synthesis and serves as a precursor for neurotransmitters such as serotonin. This compound features an indole ring structure, characteristic of tryptophan, with an acetyl group attached to the nitrogen atom of the indole moiety. The presence of the acetyl group enhances its lipophilicity, potentially influencing its biological activity and interaction with cellular membranes. Tryptophan derivatives are often studied for their roles in various physiological processes, including mood regulation and sleep patterns. Additionally, this compound may exhibit antioxidant properties and has been investigated for its potential therapeutic applications in neuropsychiatric disorders. As with many tryptophan derivatives, its solubility, stability, and reactivity can vary based on environmental conditions, making it a subject of interest in both biochemical research and pharmaceutical development.
Formula:C21H19N3O3
InChI:InChI=1S/C21H19N3O3/c25-20(10-14-12-23-18-8-4-2-6-16(14)18)24-19(21(26)27)9-13-11-22-17-7-3-1-5-15(13)17/h1-8,11-12,19,22-23H,9-10H2,(H,24,25)(H,26,27)
InChI key:InChIKey=FOSPCYZZRVNHJS-UHFFFAOYSA-N
SMILES:C(C(NC(CC=1C=2C(NC1)=CC=CC2)=O)C(O)=O)C=3C=4C(NC3)=CC=CC4
Synonyms:- Iaa-Dl-Trp
- Indole-3-Acetyl-Dl-Tryptophan
- Indolyl-3-Acetyl-Dl-Tryptophan
- N-(3-Indolylacetyl)-Dl-Tryptophan
- Tryptophan, N-(1H-indol-3-ylacetyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Indole-3-acetyl-DL-tryptophan
CAS:Indole-3-acetyl-DL-tryptophan is a useful intermediate for the synthesis of various biologically active compounds. It is a white solid that can be synthesized from indole and tryptophan using acetic acid as a catalyst. Indole-3-acetyl-DL-tryptophan has been used in the synthesis of several complex compounds, such as β-(N) indolyloxypropanal, which is a fine chemical with potential use in the production of polyurethane foam. This compound has also been found to be an effective building block for the synthesis of novel scaffolds, such as 2-(1H-indol-2-yl)-N-(2H-[1,2,4]triazol-3-yl)ethanamine. Indole 3 acetyl DL tryptophan has also been shown to be an excellent intermediate in the synthesis of other heterocycles, such as pyrazolo
Formula:C21H19N3O3Molecular weight:361.4 g/molRef: 3D-I-1700
1gTo inquire5gTo inquire10gTo inquire500mgTo inquire2500mgTo inquire-Unit-ggTo inquireIndole-3-acetyl-DL-tryptophan
CAS:Please enquire for more information about Indole-3-acetyl-DL-tryptophan including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C21H19N3O3Purity:Min. 95%Color and Shape:PowderMolecular weight:361.4 g/mol
