CAS 376646-62-7

1-(4-bromo-2-methylphenyl)methanamine

Description:

1-(4-bromo-2-methylphenyl)methanamine, with the CAS number 376646-62-7, is an organic compound characterized by its amine functional group and a substituted aromatic ring. This compound features a bromine atom and a methyl group attached to a phenyl ring, which influences its chemical reactivity and physical properties. Typically, such compounds exhibit moderate solubility in polar solvents due to the presence of the amine group, which can engage in hydrogen bonding. The bromine substituent can enhance the compound's reactivity in nucleophilic substitution reactions, while the methyl group may affect steric hindrance and electronic properties. This compound may be of interest in medicinal chemistry and material science due to its potential biological activity and utility in synthesizing more complex molecules. Safety data should be consulted for handling, as halogenated compounds can pose specific health and environmental risks. Overall, the unique structural features of 1-(4-bromo-2-methylphenyl)methanamine make it a subject of interest in various chemical research fields.

Formula: C₈H₁₀BrN

InChI: InChI=1/C8H10BrN/c1-6-4-8(9)3-2-7(6)5-10/h2-4H,5,10H2,1H3

SMILES: Cc1cc(ccc1CN)Br

Synonyms:

• 4-Bromo-2-methyl benzyl amine

4-Bromo-2-methylbenzylamine

CAS: 376646-62-7

Formula: C₈H₁₀BrN

Purity: 95%

Color and Shape: Liquid

Molecular weight: 200.0757

Ref: IN-DA00C77M

(4-Bromo-2-methylphenyl)methanamine

CAS: 376646-62-7

(4-Bromo-2-methylphenyl)methanamine

Purity: 99%

Molecular weight: 200.08g/mol

Ref: 54-OR79580

(4-Bromo-2-methylphenyl)methanamine

CAS: 376646-62-7

Formula: C₈H₁₀BrN

Purity: 95%

Color and Shape: Liquid

Molecular weight: 200.079

Ref: 10-F459082

(4-bromo-2-methylphenyl)methanamine

CAS: 376646-62-7

Versatile small molecule scaffold

Formula: C₈H₁₀BrN

Purity: Min. 95%

Molecular weight: 200.1 g/mol

Ref: 3D-BQA64662