
CAS 37669-57-1
:Ethyl 7-chloro-2,3,4,5-tetrahydro-4-oxo-5-phenyl-1H-1,5-benzodiazepine-1-carboxylate
Description:
Ethyl 7-chloro-2,3,4,5-tetrahydro-4-oxo-5-phenyl-1H-1,5-benzodiazepine-1-carboxylate is a chemical compound belonging to the benzodiazepine class, which is known for its psychoactive properties. This compound features a benzodiazepine core structure, characterized by a fused benzene and diazepine ring, with various substituents that influence its biological activity. The presence of a chloro group and a phenyl group contributes to its unique chemical reactivity and potential pharmacological effects. The ethyl ester functional group suggests that it may exhibit lipophilic properties, which can affect its absorption and distribution in biological systems. Additionally, the compound's structure indicates potential interactions with neurotransmitter systems, particularly those involving gamma-aminobutyric acid (GABA), which is a common target for benzodiazepines. Overall, this compound may have applications in medicinal chemistry, particularly in the development of anxiolytic or sedative agents, although specific biological activities and therapeutic uses would require further investigation.
Formula:C18H17ClN2O3
InChI:InChI=1S/C18H17ClN2O3/c1-2-24-18(23)20-11-10-17(22)21(14-6-4-3-5-7-14)16-12-13(19)8-9-15(16)20/h3-9,12H,2,10-11H2,1H3
InChI key:InChIKey=NXJWVCHVPUCWJS-UHFFFAOYSA-N
SMILES:C(OCC)(=O)N1C=2C(N(C(=O)CC1)C3=CC=CC=C3)=CC(Cl)=CC2
Synonyms:- Ethyl 7-chloro-2,3,4,5-tetrahydro-4-oxo-5-phenyl-1H-1,5-benzodiazepine-1-carboxylate
- Arfendazam
- 1H-1,5-Benzodiazepine-1-carboxylic acid, 7-chloro-2,3,4,5-tetrahydro-4-oxo-5-phenyl-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Arfendazam
CAS:Arfendazam is a Tranquilizer.Formula:C18H17ClN2O3Color and Shape:SolidMolecular weight:344.79
