CymitQuimica logo

CAS 37672-04-1

:

2-(aminomethyl)-4-[(7-chloroquinolin-4-yl)amino]phenol

Description:
2-(Aminomethyl)-4-[(7-chloroquinolin-4-yl)amino]phenol, with the CAS number 37672-04-1, is a chemical compound that features a complex structure incorporating both an amino group and a phenolic hydroxyl group. This compound is characterized by its quinoline moiety, which contributes to its potential biological activity, particularly in medicinal chemistry. The presence of the chloro substituent on the quinoline ring may enhance its pharmacological properties, such as antimicrobial or antitumor activities. The amino and phenolic groups suggest that this compound could participate in hydrogen bonding, influencing its solubility and reactivity. Additionally, the compound may exhibit various physical properties, including melting point and solubility, which are essential for its application in research and development. Overall, the unique structural features of this compound make it a subject of interest in the fields of organic chemistry and drug development.
Formula:C16H14ClN3O
InChI:InChI=1/C16H14ClN3O/c17-11-1-3-13-14(5-6-19-15(13)8-11)20-12-2-4-16(21)10(7-12)9-18/h1-8,21H,9,18H2,(H,19,20)
SMILES:c1cc2c(ccnc2cc1Cl)Nc1ccc(c(c1)CN)O
Synonyms:
  • N-Desethyl Amodiaquine-d5
  • Phenol,2-(aminomethyl)-4-[(7-chloro-4-quinolinyl)amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.