CAS 3768-18-1
:N4-Acetylcytidine
Description:
N4-Acetylcytidine is a modified nucleoside that is derived from cytidine, featuring an acetyl group at the nitrogen atom in the 4-position of the pyrimidine ring. This modification can influence the nucleoside's biochemical properties, including its stability and interaction with nucleic acids. N4-Acetylcytidine is known for its role in various biological processes, particularly in RNA metabolism and modification. It can be incorporated into RNA molecules, affecting their structure and function. The substance is typically soluble in water and exhibits polar characteristics due to the presence of the hydroxyl and acetyl functional groups. Its chemical formula reflects the presence of carbon, hydrogen, nitrogen, and oxygen atoms, which are essential for its biological activity. N4-Acetylcytidine is of interest in research related to gene expression, RNA processing, and potential therapeutic applications, particularly in the context of antiviral and anticancer strategies. As with many nucleoside analogs, its study contributes to the understanding of nucleic acid chemistry and the development of novel biopharmaceuticals.
Formula:C11H15N3O6
InChI:InChI=1S/C11H15N3O6/c1-5(16)12-7-2-3-14(11(19)13-7)10-9(18)8(17)6(4-15)20-10/h2-3,6,8-10,15,17-18H,4H2,1H3,(H,12,13,16,19)/t6-,8-,9-,10-/m1/s1
InChI key:InChIKey=NIDVTARKFBZMOT-PEBGCTIMSA-N
SMILES:O[C@H]1[C@@H](O[C@H](CO)[C@H]1O)N2C(=O)N=C(NC(C)=O)C=C2
Synonyms:- 4-Acetylcytidine
- 4-acetyl-1-(beta-D-ribofuranosyl)cytosine
- Acetamide, N-(1,2-dihydro-2-oxo-1-β-<span class="text-smallcaps">D</span>-ribofuranosyl-4-pyrimidinyl)-
- Cytidine, N-acetyl-
- N-4-acetylcytidine
- N-acetylcytidine
- N<sup>4</sup>-Acetylcytidine
- Acetamide, N-(1,2-dihydro-2-oxo-1-β-D-ribofuranosyl-4-pyrimidinyl)-
- Ac-rC
- N4-Acetylcytidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
N-4-Acetylcytidine
CAS:Formula:C11H15N3O6Purity:≥ 95.0%Color and Shape:White to off-white powderMolecular weight:285.25N4-Acetylcytidine
CAS:Formula:C11H15N3O6Purity:>95.0%(T)(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:285.26N-Acetylcytidine
CAS:N-AcetylcytidineFormula:C11H15N3O6Purity:98%Color and Shape: white powderMolecular weight:285.25g/molN4-Acetylcytidine
CAS:N4-Acetylcytidine: a nucleoside from tRNA degradation, urinary marker for colorectal cancer.Formula:C11H15N3O6Purity:98.53% - 98.85%Color and Shape:SolidMolecular weight:285.25N4-Acetylcytidine-13C5
CAS:Controlled ProductApplications N4-Acetylcytidine-13C5 is a labeled analogue of N4-Acetylcytidine (CAS# 3768-18-1), which is a nucleotide-derived metabolite used as biomarkers for diagnosis of inflammation-related diseases.
References Faustin, B.: Eur. Pat. Appl. 47 pp. (2017)Formula:C5C6H15N3O6Color and Shape:NeatMolecular weight:290.217N4-Acetylcytidine
CAS:Controlled ProductFormula:C11H15N3O6Color and Shape:NeatMolecular weight:285.25N4-Acetylcytidine
CAS:N4-Acetylcytidine is a modified nucleoside and endogenous urinary nucleoside product of the degradation of tRNA. N4-Acetylcytidine is a biological marker for various cancers with elevated concentrations present in urine. N4-Acetylcytidine is also a partially protected cytidine and therefore can be used as a synthetic building block to prepare further derivatized nucleosides such as 2’,3’-dideoxycytidine.Formula:C11H15N3O6Purity:Min. 95%Color and Shape:White PowderMolecular weight:285.25 g/mol







