CAS 3768-58-9: N,N,N′,N′,1,1-Hexamethylsilanediamine
Description:N,N,N′,N′,1,1-Hexamethylsilanediamine, with the CAS number 3768-58-9, is an organosilicon compound characterized by the presence of silicon atoms bonded to nitrogen and carbon. This compound features a central silicon atom surrounded by six methyl groups and two amine functional groups, which contribute to its unique chemical properties. It is typically a colorless to pale yellow liquid at room temperature and exhibits a relatively low viscosity. The presence of amine groups allows for potential reactivity in various chemical reactions, including those involving nucleophilic substitution and coordination with metal ions. Additionally, the methyl groups enhance its hydrophobic characteristics, making it less soluble in water but more compatible with organic solvents. N,N,N′,N′,1,1-Hexamethylsilanediamine is often utilized in the synthesis of silane-based materials and as a coupling agent in polymer chemistry. Its unique structure and properties make it valuable in various industrial applications, particularly in the fields of materials science and surface modification.
Formula:C6H18N2Si
InChI:InChI=1S/C6H18N2Si/c1-7(2)9(5,6)8(3)4/h1-6H3
InChI key:InChIKey=QULMGWCCKILBTO-UHFFFAOYSA-N
SMILES:N(C)(C)[Si](N(C)C)(C)C
- Synonyms:
- Bdmads
- Bis(N,N-dimethylamino)dimethylsilane
- Dimethylbis(dimethylamino)silane
- Dimethyldi(N,N-dimethylamino)silane
- Dimethylsilylbis(dimethylamine)
- Hexamethylsilanediamine
- Ls 1440
- N,N,N',N',1,1-Hexamethylsilanediamine
- Silanediamine, hexamethyl-
- [(Dimethylamino)dimethylsilyl]dimethylamine
- See more synonyms
- silanediamine, N,N,N',N',1,1-hexamethyl-
- Bis(dimethylamino)dimethylsilane
