CAS 37685-92-0

1,3-Dioxole, 4,5-difluoro-2,2-bis(trifluoromethyl)-, homopolymer

Description:

1,3-Dioxole, 4,5-difluoro-2,2-bis(trifluoromethyl)-, homopolymer, identified by CAS number 37685-92-0, is a fluorinated polymer characterized by its unique structural features and properties. This polymer is derived from the polymerization of a dioxole monomer that contains difluoro and bis(trifluoromethyl) substituents, which contribute to its thermal stability and chemical resistance. The presence of fluorine atoms enhances the polymer's hydrophobicity and makes it resistant to solvents, acids, and bases, making it suitable for various industrial applications. Additionally, the polymer exhibits low surface energy, which can be advantageous in applications requiring non-stick or anti-fog properties. Its mechanical properties, such as tensile strength and flexibility, can vary depending on the polymerization conditions and molecular weight. Overall, this homopolymer is notable for its potential use in coatings, adhesives, and other materials where durability and resistance to harsh environments are essential.

Formula: (C₅F₈O₂)x

InChI: InChI=1S/C5F8O2/c6-1-2(7)15-3(14-1,4(8,9)10)5(11,12)13

InChI key: InChIKey=YSYRISKCBOPJRG-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1(C(F)(F)F)OC(F)=C(F)O1

Synonyms:

• 1,3-Dioxole, 4,5-difluoro-2,2-bis(trifluoromethyl)-, homopolymer
• Perfluoro-2,2-dimethyl-1,3-dioxole polymer
• Poly(perfluoro-2,2-dimethyl-1,3-dioxole)
• Perfluoro-2,2-dimethyl-1,3-dioxole homopolymer
• Poly[2,2-bis(trifluoromethyl)-4,5-difluoro-1,3-dioxole]

Poly(perfluoro-2,2-dimethyl-1,3-dioxole)

CAS: 37685-92-0

Poly(perfluoro-2,2-dimethyl-1,3-dioxole)

Purity: ≥95%

Ref: 54-PC6420