CAS 37687-24-4: 1H-Pyrazole-3,5-dicarboxylic acid, 3,5-diethyl ester
Description:1H-Pyrazole-3,5-dicarboxylic acid, 3,5-diethyl ester is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features two carboxylic acid groups that are esterified with ethyl groups, contributing to its solubility and reactivity. The presence of the diethyl ester groups enhances its lipophilicity, making it more soluble in organic solvents compared to its acid form. This compound is typically used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its potential biological activity. Its structure allows for various functionalization, making it a versatile intermediate in chemical synthesis. Additionally, the presence of the pyrazole moiety is often associated with a range of biological activities, including anti-inflammatory and antimicrobial properties. As with many organic compounds, handling should be done with care, following appropriate safety protocols to mitigate any potential hazards associated with its use.
Formula:C9H12N2O4
InChI:InChI=1S/C9H12N2O4/c1-3-14-8(12)6-5-7(11-10-6)9(13)15-4-2/h5H,3-4H2,1-2H3,(H,10,11)
InChI key:InChIKey=MBWXLICVQZUJOW-UHFFFAOYSA-N
SMILES:O=C(OCC)C1=NNC(=C1)C(=O)OCC
- Synonyms:
- 1H-Pyrazole-3,5-dicarboxylic acid diethyl ester
- 1H-Pyrazole-3,5-dicarboxylic acid, 3,5-diethyl ester
- 3,5-(Diethoxycarbonyl)-1H-pyrazole
- 3,5-Diethoxycarbonylpyrazole
- 3,5-Diethyl 1H-pyrazole-3,5-dicarboxylate
- 3,5-Pyrazoledicarboxylic Acid Diethyl Ester
- Diethyl 1H-pyrazole-3,5-dicarboxylate
- Diethyl Pyrazole-3,5-Dicarboxylic Acid
- Diethyl pyrazole-3,5-dicarboxylate
- NSC 97126
- See more synonyms
