CAS 37687-34-6

6-Acetonyldihydrosanguinarine

Description:

6-Acetonyldihydrosanguinarine is a chemical compound belonging to the class of benzophenanthridine alkaloids, which are known for their diverse biological activities. This substance is characterized by its complex molecular structure, which includes a fused ring system typical of alkaloids. It is often recognized for its potential pharmacological properties, including antimicrobial and anticancer activities, making it of interest in medicinal chemistry. The compound is typically derived from plant sources, particularly from the Papaveraceae family, and exhibits a range of biological effects that may be attributed to its ability to interact with various cellular pathways. In terms of physical properties, it may exhibit moderate solubility in organic solvents, but its solubility in water is generally limited. As with many alkaloids, safety and toxicity profiles are important considerations, and further research is often necessary to fully understand its effects and potential applications in therapeutic contexts.

Formula: C₂₃H₁₉NO₅

InChI: InChI=1S/C23H19NO5/c1-12(25)7-17-21-14(5-6-18-23(21)29-11-26-18)15-4-3-13-8-19-20(28-10-27-19)9-16(13)22(15)24(17)2/h3-6,8-9,17H,7,10-11H2,1-2H3

InChI key: InChIKey=ONEHMWWDDDSJBB-UHFFFAOYSA-N

SMILES: C(C(C)=O)C1C=2C(C=3C(N1C)=C4C(=CC3)C=C5C(=C4)OCO5)=CC=C6C2OCO6

Synonyms:

• (S)-(+)-6-Acetonyldihydrosanguinarine
• 1-(13,14-Dihydro-13-methyl[1,3]benzodioxolo[5,6-c]-1,3-dioxolo[4,5-i]phenanthridin-14-yl)-2-propanone
• 2-Propanone, 1-(13,14-dihydro-13-methyl[1,3]benzodioxolo[5,6-c]-1,3-dioxolo[4,5-i]phenanthridin-14-yl)-
• 6-Acetonyl-5,6-dihydrosanguinarine
• 6-Acetonyldihydrosanguinarine
• [1,3]Benzodioxolo[5,6-c]-1,3-dioxolo[4,5-i]phenanthridine, 2-propanone deriv.

6-Acetonyldihydrosanguinarine

CAS: 37687-34-6

Formula: C₂₃H₁₉NO₅

Molecular weight: 389.4007

Ref: IN-DA00CHSR

8-Acetonyldihydrosanguinarine

CAS: 37687-34-6

8-Acetonyldihydrosanguinarine is a natural product

Formula: C₂₃H₁₉NO₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 389.4

Ref: TM-TN1303

6-Acetonyldihydrosanguinarine

CAS: 37687-34-6

Formula: C₂₃H₁₉NO₅

Purity: 95%~99%

Color and Shape: Yellow powder

Molecular weight: 389.407

Ref: BP-SBP01476

8-Acetonyldihydrosanguinarine

CAS: 37687-34-6

8-Acetonyldihydrosanguinarine is a bioactive compound, which is derived from benzophenanthridine alkaloids, specifically found in certain plant species such as the Papaveraceae family. This compound exhibits its mode of action through interaction with various biological pathways and cellular targets, leading to effects such as antimicrobial and anti-inflammatory properties. The alkaloid structure allows it to effectively bind to molecular targets within cells, thereby influencing cellular processes.

Formula: C₂₃H₁₉NO₅

Purity: Min. 95%

Molecular weight: 389.4 g/mol

Ref: 3D-MBA68734