CymitQuimica logo

CAS 3770-95-4

:

cyclohexyl phenylcarbamate

Description:
Cyclohexyl phenylcarbamate, with the CAS number 3770-95-4, is an organic compound characterized by its carbamate functional group, which consists of a cyclohexyl group attached to a phenyl ring through a carbamate linkage. This compound typically appears as a white to off-white solid and is known for its moderate solubility in organic solvents. Cyclohexyl phenylcarbamate exhibits properties that make it useful in various applications, including as a potential intermediate in organic synthesis and in the development of pharmaceuticals. Its structure contributes to its stability and reactivity, allowing it to participate in various chemical reactions, such as nucleophilic substitutions. Additionally, it may possess specific biological activities, which can be of interest in medicinal chemistry. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper safety measures are taken during its use.
Formula:C13H17NO2
InChI:InChI=1/C13H17NO2/c15-13(14-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12/h1,3-4,7-8,12H,2,5-6,9-10H2,(H,14,15)
SMILES:c1ccc(cc1)N=C(O)OC1CCCCC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.