
CAS 3770-98-7
:1,1,1-Tribromopropanone
Description:
1,1,1-Tribromopropanone is an organic compound characterized by its structure, which includes a propanone backbone with three bromine atoms attached to the first carbon. This compound is a halogenated ketone, and its molecular formula is C3H3Br3O. It typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of multiple bromine atoms significantly influences its chemical properties, making it more reactive than its non-brominated counterparts. It is known for its applications in organic synthesis, particularly in the production of various brominated compounds and as an intermediate in chemical reactions. Additionally, 1,1,1-Tribromopropanone exhibits notable polar characteristics due to the electronegative bromine atoms, which can affect its solubility in different solvents. Safety considerations are important when handling this compound, as it may pose health risks due to its halogenated nature. Proper storage and handling protocols should be followed to mitigate any potential hazards associated with its use.
Formula:C3H3Br3O
InChI:InChI=1S/C3H3Br3O/c1-2(7)3(4,5)6/h1H3
InChI key:InChIKey=OHJUXYKQXTXBTR-UHFFFAOYSA-N
SMILES:C(C(C)=O)(Br)(Br)Br
Synonyms:- 1,1,1-Tribromopropanone
- 1,1,1-Tribromo-2-propanone
- 2-Propanone, 1,1,1-tribromo-
- 1,1,1-Tribromoacetone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,1,1-Tribromoacetone
CAS:1,1,1-Tribromoacetone is a tribromide product based on bromoacetone.Formula:C3H3Br3OColor and Shape:SolidMolecular weight:294.77
