CAS 37706-60-8

(6aS,12aS)-2-(3-methylbut-2-en-1-yl)-6a,12a-dihydro-6H-[1,3]dioxolo[5,6][1]benzofuro[3,2-c]chromen-3-ol

Description:

The chemical substance with the name "(6aS,12aS)-2-(3-methylbut-2-en-1-yl)-6a,12a-dihydro-6H-[1,3]dioxolo[5,6][1]benzofuro[3,2-c]chromen-3-ol" and CAS number "37706-60-8" is a complex organic compound characterized by its unique structural features, including a fused dioxole and benzofuro chromene framework. This compound exhibits a specific stereochemistry, indicated by the (6aS,12aS) configuration, which suggests the presence of chiral centers that can influence its biological activity and interactions. The presence of a 3-methylbut-2-en-1-yl substituent contributes to its potential reactivity and solubility properties. As a member of the chromene family, it may exhibit interesting pharmacological properties, including antioxidant or anti-inflammatory activities, although specific biological data would be necessary to confirm these effects. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species, making it a subject of interest in both synthetic and medicinal chemistry.

Formula: C₂₁H₂₀O₅

InChI: InChI=1/C21H20O5/c1-11(2)3-4-12-5-14-17(7-16(12)22)23-9-15-13-6-19-20(25-10-24-19)8-18(13)26-21(14)15/h3,5-8,15,21-22H,4,9-10H2,1-2H3/t15-,21-/m1/s1

SMILES: CC(=CCc1cc2c(cc1O)OC[C@@H]1c3cc4c(cc3O[C@H]21)OCO4)C

Synonyms:

• 6H-[1,3]dioxolo[5,6]benzofuro[3,2-c][1]benzopyran-3-ol, 6a,12a-dihydro-2-(3-methyl-2-buten-1-yl)-, (6aS,12aS)-
• (6aS,12aS)-2-(3-Methylbut-2-en-1-yl)-6a,12a-dihydro-6H-[1,3]dioxolo[5,6][1]benzofuro[3,2-c]chromen-3-ol

Edunol

CAS: 37706-60-8

Edunol is a synthetic compound primarily utilized in neurochemical research. It is derived through complex organic synthesis processes, enabling the precise manipulation of molecular structures to target specific pathways in neural systems. Edunol operates by interacting with neurotransmitter receptors, modulating the activity of neural circuits, and providing insights into neuronal communication and neuromodulation.

Formula: C₂₁H₂₀O₅

Purity: Min. 95%

Molecular weight: 352.38 g/mol

Ref: 3D-XE161731