CAS 377085-57-9: Butanoic acid, 3-methyl-, 1,4-cyclohexanediylbis(methylene) ester

Description:Butanoic acid, 3-methyl-, 1,4-cyclohexanediylbis(methylene) ester, identified by CAS number 377085-57-9, is an organic compound characterized by its ester functional groups. This compound features a butanoic acid moiety, which contributes to its carboxylic acid characteristics, while the presence of a 1,4-cyclohexanediyl group indicates a cyclic structure that adds rigidity and influences its physical properties. The "3-methyl" designation suggests the presence of a methyl group on the butanoic acid chain, which can affect the compound's reactivity and solubility. Esters generally exhibit pleasant odors and are often used in flavoring and fragrance applications. The molecular structure implies potential applications in the synthesis of polymers or as intermediates in organic synthesis. Additionally, the compound's solubility in organic solvents and its stability under various conditions are typical of esters, making it a versatile substance in chemical processes. Overall, this compound's unique structure and functional groups contribute to its potential utility in various chemical applications.

Formula:C₁₈H₃₂O₄

InChI:InChI=1S/C18H32O4/c1-13(2)9-17(19)21-11-15-5-7-16(8-6-15)12-22-18(20)10-14(3)4/h13-16H,5-12H2,1-4H3

InChI key:InChIKey=HCMXPRHTVNDCEZ-UHFFFAOYSA-N

SMILES:O=C(OCC1CCC(COC(=O)CC(C)C)CC1)CC(C)C

Synonyms:
Butanoic acid, 3-methyl-, 1,4-cyclohexanediylbis(methylene) ester

Found 3 products.

Product data	Purity	Price range	Estimated delivery
1,4-Cyclohexanedimethanol Diisovalerate (cis- and trans- mixture) REF: 3B-C1135CAS: 377085-57-9	>98.0%(GC)	52.00 €	Tue 08 Apr 25
1,4-CYCLOHEXANEDIMETHANOL DIISOVALERATE REF: IN-DA003DNECAS: 377085-57-9	98%	108.00 €~198.00 €	Tue 15 Apr 25
1,4-Cyclohexanedimethanol Diisovalerate (cis- and trans- mixture) REF: 3D-CQA08557CAS: 377085-57-9	Min. 95%	- - -	Discontinued product