CAS 3771-95-7

4-Chloro-1,5,6,7-tetrahydropyrido[2,3-d]pyrimidine

Description:

4-Chloro-1,5,6,7-tetrahydropyrido[2,3-d]pyrimidine is a heterocyclic organic compound characterized by its fused pyridine and pyrimidine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 4-position enhances its reactivity and solubility in various organic solvents. This compound typically exhibits a pale yellow to brownish color and is known for its potential biological activity, making it of interest in medicinal chemistry. Its structure allows for various functionalization possibilities, which can lead to derivatives with enhanced pharmacological properties. The compound is generally stable under standard conditions but may undergo reactions typical of nitrogen-containing heterocycles, such as electrophilic substitution or nucleophilic attack. Due to its complex structure, it may also exhibit interesting electronic properties, influencing its behavior in chemical reactions. Safety data should be consulted for handling, as with many chemical substances, to ensure proper precautions are taken during use.

Formula: C₇H₈ClN₃

InChI: InChI=1/C7H8ClN3/c8-6-5-2-1-3-9-7(5)11-4-10-6/h4H,1-3H2,(H,9,10,11)

Synonyms:

• pyrido[2,3-d]pyrimidine, 4-chloro-1,5,6,7-tetrahydro-

4-Chloro-1H,5H,6H,7H-pyrido[2,3-d]pyrimidine

CAS: 3771-95-7

Versatile small molecule scaffold

Formula: C₇H₈ClN₃

Purity: Min. 95%

Molecular weight: 169.61 g/mol

Ref: 3D-DAA77195