CAS 37711-29-8
:ethyl 10H-phenothiazin-2-ylcarbamate
Description:
Ethyl 10H-phenothiazin-2-ylcarbamate, with the CAS number 37711-29-8, is a chemical compound that belongs to the phenothiazine class, which is characterized by a tricyclic structure containing sulfur and nitrogen atoms. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many phenothiazine derivatives. Ethyl 10H-phenothiazin-2-ylcarbamate may possess biological activity, often being investigated for its potential pharmacological effects, including antipsychotic or anti-inflammatory properties. The presence of the carbamate functional group suggests that it may participate in various chemical reactions, including hydrolysis and esterification. Additionally, the compound's structure may influence its interaction with biological targets, making it of interest in medicinal chemistry. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper usage and minimize risks associated with exposure.
Formula:C15H14N2O2S
InChI:InChI=1/C15H14N2O2S/c1-2-19-15(18)16-10-7-8-14-12(9-10)17-11-5-3-4-6-13(11)20-14/h3-9,17H,2H2,1H3,(H,16,18)
InChI key:InChIKey=TZCBPVYEETWLEX-UHFFFAOYSA-N
SMILES:CCOC(=Nc1ccc2c(c1)Nc1ccccc1S2)O
Synonyms:- 2-(Ethoxycarbonylamino)phenothiazine
- Carbamic acid, 10H-phenothiazin-2-yl-, ethyl ester
- Ethyl N-10H-phenothiazin-2-ylcarbamate
- Ethyl phenothiazine-2-carbamate
- Phenothiazine-2-carbamic acid, ethyl ester
- carbamic acid, N-10H-phenothiazin-2-yl-, ethyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Ethyl phenothiazine-2-carbamate
CAS:Ethyl phenothiazine-2-carbamate is a versatile building block that can be used in the synthesis of complex compounds. It has a CAS number of 37711-29-8 and is soluble in organic solvents such as ethanol, acetone, and chloroform. Ethyl phenothiazine-2-carbamate can be used for research and to make reagents and speciality chemicals. This compound is useful in the synthesis of high quality chemical products like pharmaceuticals, agrochemicals, cosmetics, and flavors. It can also be used as an intermediate or scaffold in organic syntheses.
Formula:C15H14N2O2SPurity:Min. 95%Molecular weight:286.35 g/mol

