CAS 37718-11-9: Pyrazole-4-carboxylic acid
Description:Pyrazole-4-carboxylic acid is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features a carboxylic acid functional group (-COOH) at the 4-position of the pyrazole ring, contributing to its acidic properties. Pyrazole-4-carboxylic acid is typically a white to off-white crystalline solid, and it is soluble in polar solvents such as water and alcohols due to the presence of the carboxylic acid group. The compound is of interest in various fields, including medicinal chemistry and agrochemicals, due to its potential biological activities and applications in the synthesis of other pyrazole derivatives. Its reactivity can be attributed to the electron-withdrawing nature of the carboxylic acid group, which can influence its behavior in chemical reactions. Additionally, the compound may exhibit various physical properties such as melting point and boiling point, which are essential for its characterization and application in research and industry.
Formula:C4H4N2O2
InChI:InChI=1S/C4H4N2O2/c7-4(8)3-1-5-6-2-3/h1-2H,(H,5,6)(H,7,8)
InChI key:InChIKey=IMBBXSASDSZJSX-UHFFFAOYSA-N
SMILES:O=C(O)C=1C=NNC1
- Synonyms:
- 1H-pyrazole-4-carboxylic acid
- 4-Carboxypyrazole
- Pyrazole-4-carboxylic acid

1 H -Pyrazole-4-carboxylic acid
Ref: 10-F028020
1g | 9.00 € | ||
5g | 13.00 € | ||
10g | 23.00 € | ||
25g | 40.00 € | ||
100g | 126.00 € | ||
500g | 542.00 € |

Pyrazole-4-carboxylic Acid
Ref: 3B-P1978
1g | 75.00 € | ||
5g | 210.00 € |

1H-Pyrazole-4-carboxylic acid, 97%
Ref: 02-H25783
1g | To inquire | ||
5g | To inquire |

4-Pyrazolecarboxylic Acid
Ref: IN-DA003453
1g | 25.00 € | ||
5g | 26.00 € | ||
10g | 39.00 € | ||
25g | 61.00 € | ||
100g | 173.00 € | ||
500g | 569.00 € |

1H-Pyrazole-4-carboxylic acid
Ref: 54-OR30825
5g | 37.00 € | ||
10g | 45.00 € | ||
25g | 82.00 € |

4-Carboxypyrazole
Ref: TM-T35949
500mg | 49.00 € |

4-Pyrazolecarboxylic acid, 97%
Ref: AC-39685
100mg | To inquire | ||
500mg | To inquire |

4-Pyrazolecarboxylic acid
Ref: 3D-FP27278
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
50g | Discontinued | Request information | |
100g | Discontinued | Request information |